2-(4-(2-(N-(4-chlorophenyl)picolinamido)ethyl)-3,4-dihydro-2H-benzo[b][1,4]oxazin-8-yloxy)acetic acid

ID: ALA3792396

PubChem CID: 58602769

Max Phase: Preclinical

Molecular Formula: C24H22ClN3O5

Molecular Weight: 467.91

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)COc1cccc2c1OCCN2CCN(C(=O)c1ccccn1)c1ccc(Cl)cc1

Standard InChI:  InChI=1S/C24H22ClN3O5/c25-17-7-9-18(10-8-17)28(24(31)19-4-1-2-11-26-19)13-12-27-14-15-32-23-20(27)5-3-6-21(23)33-16-22(29)30/h1-11H,12-16H2,(H,29,30)

Standard InChI Key:  KHXKVQBYZFYFKN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   -1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964   -1.4973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    1.4973    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2907   -2.9981    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5870   -3.7544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5812   -5.2552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6177   -5.8599    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5395   -5.8509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2995    2.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003    3.7467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6034    5.2475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3050    6.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9042    5.9961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9073    7.4969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9424    5.3943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2064    8.2470    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2064    9.7470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9074   10.4970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6083    9.7470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6083    8.2470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3055    7.5002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0068    8.2507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2926    7.5012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2931    6.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0056    5.2507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3316    8.1016    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  6  2  0
  5  2  2  0
  2  3  1  0
  3  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  1 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 13 15  1  0
 10 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 21  1  0
 19 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 19  1  0
 30 33  1  0
M  END

Associated Targets(non-human)

Canis familiaris (36305 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 467.91Molecular Weight (Monoisotopic): 467.1248AlogP: 3.74#Rotatable Bonds: 8
Polar Surface Area: 92.20Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 3.60CX Basic pKa: 0.72CX LogP: 3.60CX LogD: 0.26
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.54Np Likeness Score: -1.61

References

1. Hayashi R, Sakagami H, Koiwa M, Ito H, Miyamoto M, Isogaya M..  (2016)  Piperidine derivatives as nonprostanoid IP receptor agonists.,  26  (9): [PMID:26996371] [10.1016/j.bmcl.2016.03.009]

Source