The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(2-(N-(4-chlorophenyl)picolinamido)ethyl)-3,4-dihydro-2H-benzo[b][1,4]oxazin-8-yloxy)acetic acid ID: ALA3792396
PubChem CID: 58602769
Max Phase: Preclinical
Molecular Formula: C24H22ClN3O5
Molecular Weight: 467.91
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)COc1cccc2c1OCCN2CCN(C(=O)c1ccccn1)c1ccc(Cl)cc1
Standard InChI: InChI=1S/C24H22ClN3O5/c25-17-7-9-18(10-8-17)28(24(31)19-4-1-2-11-26-19)13-12-27-14-15-32-23-20(27)5-3-6-21(23)33-16-22(29)30/h1-11H,12-16H2,(H,29,30)
Standard InChI Key: KHXKVQBYZFYFKN-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 -2.9981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 -3.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5812 -5.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6177 -5.8599 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5395 -5.8509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2995 2.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 3.7467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6034 5.2475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3050 6.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9042 5.9961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9073 7.4969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9424 5.3943 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2064 8.2470 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2064 9.7470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9074 10.4970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6083 9.7470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6083 8.2470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3055 7.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0068 8.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2926 7.5012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2931 6.0012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0056 5.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3316 8.1016 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 6 2 0
5 2 2 0
2 3 1 0
3 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
1 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
13 15 1 0
10 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 1 0
20 21 1 0
20 22 2 0
21 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 21 1 0
19 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 19 1 0
30 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 467.91Molecular Weight (Monoisotopic): 467.1248AlogP: 3.74#Rotatable Bonds: 8Polar Surface Area: 92.20Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.60CX Basic pKa: 0.72CX LogP: 3.60CX LogD: 0.26Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.54Np Likeness Score: -1.61
References 1. Hayashi R, Sakagami H, Koiwa M, Ito H, Miyamoto M, Isogaya M.. (2016) Piperidine derivatives as nonprostanoid IP receptor agonists., 26 (9): [PMID:26996371 ] [10.1016/j.bmcl.2016.03.009 ]