(2R,3R)-2-(3,4-dihydroxyphenyl)-8-((1aS,7R,7aR)-1a-(3,4-dihydroxyphenyl)-4,6-dihydroxy-7,7a-dihydro-1aH-oxireno[2,3-b]chromen-7-yl)chroman-3,5,7-triol

ID: ALA3792892

PubChem CID: 101784404

Max Phase: Preclinical

Molecular Formula: C30H24O12

Molecular Weight: 576.51

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Oc1cc(O)c2c(c1)O[C@]1(c3ccc(O)c(O)c3)O[C@@H]1[C@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@H](O)C2

Standard InChI:  InChI=1S/C30H24O12/c31-13-7-20(37)24-23(8-13)41-30(12-2-4-16(33)19(36)6-12)29(42-30)26(24)25-21(38)10-17(34)14-9-22(39)27(40-28(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-27,29,31-39H,9H2/t22-,26-,27-,29-,30-/m1/s1

Standard InChI Key:  MSVVDBMAVSBGAQ-MYDWLSLHSA-N

Molfile:  

     RDKit          2D

 43 49  0  0  0  0  0  0  0  0999 V2000
   -4.1411    0.2372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1411   -1.2587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8641   -2.0067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8641    0.9851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5689    0.2372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5689   -1.2770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2554   -2.0249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2554    1.0033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7722    1.5367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2722    1.5365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0224    2.8354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2726    4.1346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7726    4.1348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0224    2.8359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8742   -3.2067    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1822    0.8339    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0216    0.2372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0216   -1.2770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3351   -0.4926    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2462   -3.5257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5530   -4.2869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5389   -5.7841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2173   -6.5204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0580   -4.2624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0721   -5.7597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3755   -6.4961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6648   -5.7354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6508   -4.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3474   -3.5017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9434   -3.4757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9319   -1.9757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2250   -1.2156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5299   -1.9555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5415   -3.4554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2483   -4.2155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7096   -6.3256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1728    5.1741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8728    5.1737    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2157   -0.0156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5644   -1.3474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2024   -7.7203    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5961   -3.6938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5125   -0.4163    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5  8  1  0
  6  7  1  0
  7 18  1  0
 17  8  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 17  9  1  1
  3 15  1  0
  1 16  1  0
 18 17  1  0
 18 19  1  0
 17 19  1  0
  7 20  1  1
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 25  1  0
 24 20  1  0
 24 25  2  0
 24 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 28 30  1  6
 27 36  1  6
 13 37  1  0
 12 38  1  0
 32 39  1  0
 33 40  1  0
 23 41  1  0
 21 42  1  0
 18 43  1  1
M  END

Associated Targets(Human)

PDE4D Tclin Phosphodiesterase 4D (3546 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 576.51Molecular Weight (Monoisotopic): 576.1268AlogP: 3.14#Rotatable Bonds: 3
Polar Surface Area: 213.06Molecular Species: NEUTRALHBA: 12HBD: 9
#RO5 Violations: 3HBA (Lipinski): 12HBD (Lipinski): 9#RO5 Violations (Lipinski): 3
CX Acidic pKa: 8.75CX Basic pKa: CX LogP: 4.09CX LogD: 4.06
Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.13Np Likeness Score: 2.08

References

1. Cai YH, Guo Y, Li Z, Wu D, Li X, Zhang H, Yang J, Lu H, Sun Z, Luo HB, Yin S, Wu Y..  (2016)  Discovery and modelling studies of natural ingredients from Gaultheria yunnanensis (FRANCH.) against phosphodiesterase-4.,  114  [PMID:26978121] [10.1016/j.ejmech.2015.12.002]

Source