The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(6-(10H-benzo[b]pyrido[2,3-e][1,4]thiazin-10-yl)hexyl)isoindoline-1,3-dione ID: ALA3793198
PubChem CID: 127028572
Max Phase: Preclinical
Molecular Formula: C25H23N3O2S
Molecular Weight: 429.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C1c2ccccc2C(=O)N1CCCCCCN1c2ccccc2Sc2cccnc21
Standard InChI: InChI=1S/C25H23N3O2S/c29-24-18-10-3-4-11-19(18)25(30)28(24)17-8-2-1-7-16-27-20-12-5-6-13-21(20)31-22-14-9-15-26-23(22)27/h3-6,9-15H,1-2,7-8,16-17H2
Standard InChI Key: HVOQOYLDKVVHHC-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
-3.8968 0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8968 -0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5978 -1.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5978 1.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2989 0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2989 -0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5002 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5002 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2806 0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2806 -0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5978 -1.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8968 -0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8968 0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5978 1.5002 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0120 3.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3173 3.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3293 5.2425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6346 5.9832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6467 7.4840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9520 8.2248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9640 9.7255 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1642 10.5612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7579 10.5989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6147 10.2339 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2979 10.1677 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2359 12.0137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7308 11.9902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5167 13.2725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7717 14.5971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2769 14.6206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4906 13.3200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 8 1 0
6 7 1 0
7 10 1 0
9 8 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
8 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 27 1 0
26 23 1 0
23 21 1 0
23 24 2 0
22 25 2 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 429.55Molecular Weight (Monoisotopic): 429.1511AlogP: 5.54#Rotatable Bonds: 7Polar Surface Area: 53.51Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.10CX LogP: 5.44CX LogD: 5.44Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.36Np Likeness Score: -0.96
References 1. Kushwaha K, Kaushik NK, Kaushik N, Chand M, Kaushik R, Choi EH, Jain SC.. (2016) Novel aminoalkylated azaphenothiazines as potential inhibitors of T98G, H460 and SNU80 cancer cell lines in vitro., 26 (9): [PMID:27017112 ] [10.1016/j.bmcl.2016.03.056 ]