The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-isopropoxy-4-(5-phenylfuran-2-yl)phenyl)picolinimidamide ID: ALA3793592
PubChem CID: 127029135
Max Phase: Preclinical
Molecular Formula: C25H23N3O2
Molecular Weight: 397.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)Oc1cc(-c2ccc(-c3ccccc3)o2)ccc1NC(=N)c1ccccn1
Standard InChI: InChI=1S/C25H23N3O2/c1-17(2)29-24-16-19(23-14-13-22(30-23)18-8-4-3-5-9-18)11-12-20(24)28-25(26)21-10-6-7-15-27-21/h3-17H,1-2H3,(H2,26,28)
Standard InChI Key: DZMUHJLDKBFVKH-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 1.4978 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8969 -0.4545 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4994 0.7433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7985 1.4933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7985 2.9933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4995 3.7433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2004 2.9933 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9511 -0.8815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9530 -1.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2010 -3.2957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7343 -2.9815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4458 -1.8433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1563 -0.5279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.6557 -0.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.4415 -1.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.7279 -3.0832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2285 -3.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3064 4.9494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3421 3.1476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
9 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 9 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 16 2 0
5 16 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
18 21 1 0
3 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 397.48Molecular Weight (Monoisotopic): 397.1790AlogP: 6.23#Rotatable Bonds: 6Polar Surface Area: 71.14Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.56CX LogP: 5.14CX LogD: 5.14Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.30Np Likeness Score: -0.87
References 1. Zhu X, Farahat AA, Mattamana M, Joice A, Pandharkar T, Holt E, Banerjee M, Gragg JL, Hu L, Kumar A, Yang S, Wang MZ, Boykin DW, Werbovetz KA.. (2016) Synthesis and pharmacological evaluation of mono-arylimidamides as antileishmanial agents., 26 (10): [PMID:27048943 ] [10.1016/j.bmcl.2016.03.082 ]