The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
10-(6-(4-(Benzo[d][1,3]dioxol-5-ylmethyl)piperazin-1-yl)hexyl)-10H-benzo[b]pyrido[2,3-e][1,4]thiazine ID: ALA3793777
PubChem CID: 127029434
Max Phase: Preclinical
Molecular Formula: C29H34N4O2S
Molecular Weight: 502.68
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: c1ccc2c(c1)Sc1cccnc1N2CCCCCCN1CCN(Cc2ccc3c(c2)OCO3)CC1
Standard InChI: InChI=1S/C29H34N4O2S/c1(2-6-15-33-24-8-3-4-9-27(24)36-28-10-7-13-30-29(28)33)5-14-31-16-18-32(19-17-31)21-23-11-12-25-26(20-23)35-22-34-25/h3-4,7-13,20H,1-2,5-6,14-19,21-22H2
Standard InChI Key: QKQBZIDKURWDHD-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
-3.8968 0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8968 -0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5978 -1.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5978 1.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2989 0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2989 -0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5002 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5002 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2806 0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2806 -0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5978 -1.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8968 -0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8968 0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5978 1.5002 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0120 3.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3173 3.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3293 5.2425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6346 5.9832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6467 7.4840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9520 8.2248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9640 9.7255 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2675 10.4678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2766 11.9678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9821 12.7256 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6785 11.9834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6695 10.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9880 14.2264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6917 14.9828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7041 16.4789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3974 17.2549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3738 14.2285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0853 15.0043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0970 16.4993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3215 16.9662 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2061 15.7516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3403 14.5597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 8 1 0
6 7 1 0
7 10 1 0
9 8 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
8 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
24 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 33 2 0
32 31 2 0
31 28 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 502.68Molecular Weight (Monoisotopic): 502.2402AlogP: 5.79#Rotatable Bonds: 9Polar Surface Area: 41.07Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.30CX LogP: 5.91CX LogD: 4.96Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.34Np Likeness Score: -1.10
References 1. Kushwaha K, Kaushik NK, Kaushik N, Chand M, Kaushik R, Choi EH, Jain SC.. (2016) Novel aminoalkylated azaphenothiazines as potential inhibitors of T98G, H460 and SNU80 cancer cell lines in vitro., 26 (9): [PMID:27017112 ] [10.1016/j.bmcl.2016.03.056 ]