The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
10-(6-(4-(Pyrrolidin-1-yl)piperidin-1-yl)hexyl)-10H-benzo[b]pyrido[2,3-e][1,4]thiazine ID: ALA3793866
PubChem CID: 127029435
Max Phase: Preclinical
Molecular Formula: C26H36N4S
Molecular Weight: 436.67
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: c1ccc2c(c1)Sc1cccnc1N2CCCCCCN1CCC(N2CCCC2)CC1
Standard InChI: InChI=1S/C26H36N4S/c1(5-16-28-20-13-22(14-21-28)29-17-7-8-18-29)2-6-19-30-23-10-3-4-11-24(23)31-25-12-9-15-27-26(25)30/h3-4,9-12,15,22H,1-2,5-8,13-14,16-21H2
Standard InChI Key: MCLOERVVCNFRGV-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
-3.8968 0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8968 -0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5978 -1.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5978 1.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2989 0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2989 -0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5002 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5002 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2806 0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2806 -0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5978 -1.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8968 -0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8968 0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5978 1.5002 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0120 3.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3173 3.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3293 5.2425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6346 5.9832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6467 7.4840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9520 8.2248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9640 9.7255 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2675 10.4678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2766 11.9678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9821 12.7256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6785 11.9834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6695 10.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9911 14.2263 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2084 15.0808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7512 16.5094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2512 16.5160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7814 15.0915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 8 1 0
6 7 1 0
7 10 1 0
9 8 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
8 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 27 1 0
24 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 436.67Molecular Weight (Monoisotopic): 436.2661AlogP: 5.80#Rotatable Bonds: 8Polar Surface Area: 22.61Molecular Species: BASEHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.23CX LogP: 5.15CX LogD: 2.10Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.49Np Likeness Score: -1.22
References 1. Kushwaha K, Kaushik NK, Kaushik N, Chand M, Kaushik R, Choi EH, Jain SC.. (2016) Novel aminoalkylated azaphenothiazines as potential inhibitors of T98G, H460 and SNU80 cancer cell lines in vitro., 26 (9): [PMID:27017112 ] [10.1016/j.bmcl.2016.03.056 ]