The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-isopropoxy-4-(5-(2-methoxyphenyl)furan-2-yl)phenyl)picolinimidamide ID: ALA3793898
PubChem CID: 127029134
Max Phase: Preclinical
Molecular Formula: C26H25N3O3
Molecular Weight: 427.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1-c1ccc(-c2ccc(NC(=N)c3ccccn3)cc2OC(C)C)o1
Standard InChI: InChI=1S/C26H25N3O3/c1-17(2)31-25-16-18(29-26(27)21-9-6-7-15-28-21)11-12-20(25)24-14-13-23(32-24)19-8-4-5-10-22(19)30-3/h4-17H,1-3H3,(H2,27,29)
Standard InChI Key: WLGRAMWKUNHOSS-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 -3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 -3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3064 -4.9494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3421 -3.1476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5972 1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5548 3.6021 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 5.2571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1924 6.0071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4914 5.2571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 3.7571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1925 3.0071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9511 -0.8815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9530 -1.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2010 -3.2957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7343 -2.9815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4458 -1.8433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2285 -3.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.7279 -3.0832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.4415 -1.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.6557 -0.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1563 -0.5279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3711 0.7512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.9422 1.8066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 1 0
8 10 1 0
2 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 13 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 20 2 0
5 20 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
22 25 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 427.50Molecular Weight (Monoisotopic): 427.1896AlogP: 6.24#Rotatable Bonds: 7Polar Surface Area: 80.37Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.28CX LogP: 4.98CX LogD: 4.98Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.27Np Likeness Score: -0.81
References 1. Zhu X, Farahat AA, Mattamana M, Joice A, Pandharkar T, Holt E, Banerjee M, Gragg JL, Hu L, Kumar A, Yang S, Wang MZ, Boykin DW, Werbovetz KA.. (2016) Synthesis and pharmacological evaluation of mono-arylimidamides as antileishmanial agents., 26 (10): [PMID:27048943 ] [10.1016/j.bmcl.2016.03.082 ]