The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-{2-[4-(4-bromobenzoyl)-2-methyl-phenoxy]-acetylamino}-phenyl)-2-[2-methyl-4-(2-methylbenzoyl)-phenoxy]-acetamide ID: ALA3794405
PubChem CID: 127027906
Max Phase: Preclinical
Molecular Formula: C39H33BrN2O6
Molecular Weight: 705.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C(=O)c2ccc(Br)cc2)ccc1OCC(=O)Nc1ccccc1NC(=O)COc1ccc(C(=O)c2ccccc2C)cc1C
Standard InChI: InChI=1S/C39H33BrN2O6/c1-24-8-4-5-9-31(24)39(46)29-15-19-35(26(3)21-29)48-23-37(44)42-33-11-7-6-10-32(33)41-36(43)22-47-34-18-14-28(20-25(34)2)38(45)27-12-16-30(40)17-13-27/h4-21H,22-23H2,1-3H3,(H,41,43)(H,42,44)
Standard InChI Key: BZPIOZCQYILNHG-UHFFFAOYSA-N
Molfile:
RDKit 2D
48 52 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3070 5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3421 3.1476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6078 5.9988 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6109 7.4996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9099 8.2497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9099 9.7497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6109 10.4997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3118 9.7497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3118 8.2497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6078 12.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6460 12.6023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3070 12.7491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3018 14.2491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0002 14.9947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2963 14.2402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2911 12.7402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0105 11.9947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2003 1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8969 -0.4545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4990 0.7409 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.8003 1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0994 0.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3984 1.4886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3985 2.9886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0995 3.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8004 2.9887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6967 3.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6946 5.2425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.7370 3.1435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-12.9911 5.9971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9859 7.4971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6843 8.2426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3879 7.4881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3930 5.9882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9491 7.6497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3389 14.8527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0994 -0.4613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6802 9.4426 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
9 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
15 18 1 0
18 19 2 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
4 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
34 37 1 0
37 38 1 0
37 39 2 0
38 40 2 0
40 41 1 0
41 42 2 0
42 43 1 0
43 44 2 0
44 38 1 0
13 45 1 0
21 46 1 0
32 47 1 0
42 48 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 705.61Molecular Weight (Monoisotopic): 704.1522AlogP: 7.87#Rotatable Bonds: 12Polar Surface Area: 110.80Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.63CX Basic pKa: ┄CX LogP: 8.71CX LogD: 8.71Aromatic Rings: 5Heavy Atoms: 48QED Weighted: 0.13Np Likeness Score: -0.86
References 1. Zabiulla, Shamanth Neralagundi HG, Bushra Begum A, Prabhakar BT, Khanum SA.. (2016) Design and synthesis of diamide-coupled benzophenones as potential anticancer agents., 115 [PMID:27027818 ] [10.1016/j.ejmech.2016.03.040 ]