N-(2-{2-[4-(4-bromobenzoyl)-2-methyl-phenoxy]-acetylamino}-phenyl)-2-[2-methyl-4-(2-methylbenzoyl)-phenoxy]-acetamide

ID: ALA3794405

PubChem CID: 127027906

Max Phase: Preclinical

Molecular Formula: C39H33BrN2O6

Molecular Weight: 705.61

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(C(=O)c2ccc(Br)cc2)ccc1OCC(=O)Nc1ccccc1NC(=O)COc1ccc(C(=O)c2ccccc2C)cc1C

Standard InChI:  InChI=1S/C39H33BrN2O6/c1-24-8-4-5-9-31(24)39(46)29-15-19-35(26(3)21-29)48-23-37(44)42-33-11-7-6-10-32(33)41-36(43)22-47-34-18-14-28(20-25(34)2)38(45)27-12-16-30(40)17-13-27/h4-21H,22-23H2,1-3H3,(H,41,43)(H,42,44)

Standard InChI Key:  BZPIOZCQYILNHG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 48 52  0  0  0  0  0  0  0  0999 V2000
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0031    3.0008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3039    3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3070    5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3421    3.1476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6078    5.9988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6109    7.4996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9099    8.2497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9099    9.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6109   10.4997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3118    9.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3118    8.2497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6078   12.0005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6460   12.6023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3070   12.7491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3018   14.2491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0002   14.9947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2963   14.2402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2911   12.7402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0105   11.9947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003    1.4977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8990    0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2003    1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8969   -0.4545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4990    0.7409    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8003    1.4887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0994    0.7387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3984    1.4886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3985    2.9886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0995    3.7387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8004    2.9887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6967    3.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6946    5.2425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.7370    3.1435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9911    5.9971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9859    7.4971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6843    8.2426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3879    7.4881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3930    5.9882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9491    7.6497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3389   14.8527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0994   -0.4613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6802    9.4426    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 15 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
  4 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 34 37  1  0
 37 38  1  0
 37 39  2  0
 38 40  2  0
 40 41  1  0
 41 42  2  0
 42 43  1  0
 43 44  2  0
 44 38  1  0
 13 45  1  0
 21 46  1  0
 32 47  1  0
 42 48  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3794405

    ---

Associated Targets(Human)

MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A549 (127892 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Chorioallantoic membrane (375 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 705.61Molecular Weight (Monoisotopic): 704.1522AlogP: 7.87#Rotatable Bonds: 12
Polar Surface Area: 110.80Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.63CX Basic pKa: CX LogP: 8.71CX LogD: 8.71
Aromatic Rings: 5Heavy Atoms: 48QED Weighted: 0.13Np Likeness Score: -0.86

References

1. Zabiulla, Shamanth Neralagundi HG, Bushra Begum A, Prabhakar BT, Khanum SA..  (2016)  Design and synthesis of diamide-coupled benzophenones as potential anticancer agents.,  115  [PMID:27027818] [10.1016/j.ejmech.2016.03.040]

Source