1-(4-(2-chlorobenzyloxy)-6-hydroxy-7-methoxybenzofuran-5-yl)ethanone

ID: ALA379468

PubChem CID: 11523087

Max Phase: Preclinical

Molecular Formula: C18H15ClO5

Molecular Weight: 346.77

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1c(O)c(C(C)=O)c(OCc2ccccc2Cl)c2ccoc12

Standard InChI:  InChI=1S/C18H15ClO5/c1-10(20)14-15(21)18(22-2)17-12(7-8-23-17)16(14)24-9-11-5-3-4-6-13(11)19/h3-8,21H,9H2,1-2H3

Standard InChI Key:  SZKNMFCBJRGPGJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
    4.0013   -1.3959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7187   -1.8075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4353   -1.3876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4294   -0.5635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9989   -0.5705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7161   -0.1549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5425    0.6557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7179    0.7411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3821   -0.0167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1416   -0.1472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1373    0.6778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8496    1.0941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5684    0.6812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2802    1.0967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2715    1.9198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5546    2.3311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8458    1.9132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1525   -1.7952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1582   -2.6201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8642   -1.3778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7226   -2.6325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2880   -1.8105    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2903   -2.6355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5713   -0.1438    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
 11 12  1  0
  5  1  1  0
 12 13  2  0
  2  3  1  0
 13 14  1  0
 14 15  2  0
  3  4  2  0
 15 16  1  0
  6  7  1  0
 16 17  2  0
 17 12  1  0
  7  8  2  0
  3 18  1  0
  8  9  1  0
 18 19  1  0
  9  5  1  0
 18 20  2  0
  4  6  1  0
  2 21  1  0
  4 10  1  0
  1 22  1  0
  5  6  2  0
 22 23  1  0
 10 11  1  0
 13 24  1  0
M  END

Associated Targets(non-human)

Kcna3 Voltage-gated potassium channel subunit Kv1.3 (114 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 346.77Molecular Weight (Monoisotopic): 346.0608AlogP: 4.58#Rotatable Bonds: 5
Polar Surface Area: 68.90Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.58CX Basic pKa: CX LogP: 4.05CX LogD: 4.02
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.68Np Likeness Score: 0.36

References

1. Harvey AJ, Baell JB, Toovey N, Homerick D, Wulff H..  (2006)  A new class of blockers of the voltage-gated potassium channel Kv1.3 via modification of the 4- or 7-position of khellinone.,  49  (4): [PMID:16480279] [10.1021/jm050839v]

Source