3-(cyclohexyl(1-(2,6-dimethylphenyl)-1H-tetrazol-5-yl)methyl)-2,3,5,6-tetrahydroazepino[4,5-b]indol-4(1H)-one

ID: ALA3797430

PubChem CID: 72696445

Max Phase: Preclinical

Molecular Formula: C28H32N6O

Molecular Weight: 468.61

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(C)c1-n1nnnc1C(C1CCCCC1)N1CCc2c([nH]c3ccccc23)CC1=O

Standard InChI:  InChI=1S/C28H32N6O/c1-18-9-8-10-19(2)26(18)34-28(30-31-32-34)27(20-11-4-3-5-12-20)33-16-15-22-21-13-6-7-14-23(21)29-24(22)17-25(33)35/h6-10,13-14,20,27,29H,3-5,11-12,15-17H2,1-2H3

Standard InChI Key:  NQTKWEVZPLFYTG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
   -3.6097    3.5911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0975    2.0886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0829    0.9959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1463    3.9228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1316    2.8106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5999    1.3666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3902    0.5276    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.8001    1.4252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3513    2.8106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1904    4.0789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1855    0.8788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6928    4.1764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4928    1.6398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7075    3.0642    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4855    0.9656    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1509    3.4836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5102    4.9407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2099    5.6627    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5147    7.1314    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0057    7.2954    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6225    5.9281    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2335    2.4442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7301    2.3420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3900    0.9950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5533   -0.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0568   -0.1480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3969    1.1991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0901    5.6144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6610    4.2330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1481    4.0370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0615    5.2268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4877    6.6127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0005    6.8088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5397    7.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9300    3.2813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  9  5  1  0
  8  9  2  0
  9 10  1  0
  8 11  1  0
 10 12  1  0
 11 13  1  0
 12 14  1  0
 13 14  1  0
 13 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 17  1  0
 22 23  1  0
 22 27  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 16 22  1  0
 21 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 33 34  1  0
 29 35  1  0
M  END

Associated Targets(non-human)

Htr6 Serotonin 6 (5-HT6) receptor (86 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.61Molecular Weight (Monoisotopic): 468.2638AlogP: 5.01#Rotatable Bonds: 4
Polar Surface Area: 79.70Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.50CX LogD: 5.50
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.46Np Likeness Score: -0.90

References

1. Rentería-Gómez A, Islas-Jácome A, Díaz-Cervantes E, Villaseñor-Granados T, Robles J, Gámez-Montaño R..  (2016)  Synthesis of azepino[4,5-b]indol-4-ones via MCR/free radical cyclization and in vitro-in silico studies as 5-Ht₆R ligands.,  26  (9): [PMID:26996373] [10.1016/j.bmcl.2016.03.036]

Source