3-((1-tert-butyl-1H-tetrazol-5-yl)(2,3-dimethoxyphenyl)methyl)-2,3,5,6-tetrahydroazepino[4,5-b]indol-4(1H)-one

ID: ALA3797434

PubChem CID: 72696441

Max Phase: Preclinical

Molecular Formula: C26H30N6O3

Molecular Weight: 474.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc(C(c2nnnn2C(C)(C)C)N2CCc3c([nH]c4ccccc34)CC2=O)c1OC

Standard InChI:  InChI=1S/C26H30N6O3/c1-26(2,3)32-25(28-29-30-32)23(18-10-8-12-21(34-4)24(18)35-5)31-14-13-17-16-9-6-7-11-19(16)27-20(17)15-22(31)33/h6-12,23,27H,13-15H2,1-5H3

Standard InChI Key:  BYEIXIKFOVPWNG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   13.8618   -0.3853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5977   -1.9427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1921   -2.4406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7188    0.5870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3042    0.0718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0499   -1.4247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5890   -1.6075    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9504   -0.2604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9902    0.7591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8346    2.2719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4696   -0.1024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5485    3.0548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6639    1.1779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1339    2.5395    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6705    1.0635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0486    3.5794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6076    3.1599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4448    4.0872    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2029    3.2460    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6191    1.8049    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1183    1.7555    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4068    5.0368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8482    5.4523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2091    6.9082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1287    7.9488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6874    7.5334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3264    6.0774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8851    5.6589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6459    4.6880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6085    8.5767    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8989    9.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9680    0.5215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4531   -0.5624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1642    0.6172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6491   -0.4665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  9  5  1  0
  8  9  2  0
  9 10  1  0
  8 11  1  0
 10 12  1  0
 11 13  1  0
 12 14  1  0
 13 14  1  0
 13 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 17  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 16 22  1  0
 27 28  1  0
 28 29  1  0
 26 30  1  0
 30 31  1  0
 21 32  1  0
 32 33  1  0
 32 34  1  0
 32 35  1  0
M  END

Associated Targets(non-human)

Htr6 Serotonin 6 (5-HT6) receptor (86 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 474.57Molecular Weight (Monoisotopic): 474.2379AlogP: 3.64#Rotatable Bonds: 5
Polar Surface Area: 98.16Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.16CX LogD: 3.16
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.47Np Likeness Score: -1.00

References

1. Rentería-Gómez A, Islas-Jácome A, Díaz-Cervantes E, Villaseñor-Granados T, Robles J, Gámez-Montaño R..  (2016)  Synthesis of azepino[4,5-b]indol-4-ones via MCR/free radical cyclization and in vitro-in silico studies as 5-Ht₆R ligands.,  26  (9): [PMID:26996373] [10.1016/j.bmcl.2016.03.036]

Source