The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(rac)-3-{[(Z)-(6-fluoro-2-methoxy-4-oxo-2H-chromen-3(4H)-ylidene)methyl]amino}benzenesulfonamide ID: ALA3797468
PubChem CID: 127047726
Max Phase: Preclinical
Molecular Formula: C17H15FN2O5S
Molecular Weight: 378.38
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC1Oc2ccc(F)cc2C(=O)/C1=C\Nc1cccc(S(N)(=O)=O)c1
Standard InChI: InChI=1S/C17H15FN2O5S/c1-24-17-14(16(21)13-7-10(18)5-6-15(13)25-17)9-20-11-3-2-4-12(8-11)26(19,22)23/h2-9,17,20H,1H3,(H2,19,22,23)/b14-9+
Standard InChI Key: RQVVPIPKLIKWED-NTEUORMPSA-N
Molfile:
RDKit 2D
26 28 0 0 0 0 0 0 0 0999 V2000
5.4776 -8.0954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5140 -7.4905 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.5559 -8.0859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -2.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8911 1.5017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8942 -1.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8982 -2.9972 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1995 -3.7449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2058 -5.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5078 -5.9896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8038 -5.2343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7977 -3.7343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4956 -2.9897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8894 2.7017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5195 -8.6904 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6486 -1.3517 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
10 14 2 0
12 15 1 0
11 16 2 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
15 24 1 0
20 2 1 0
2 25 1 0
5 26 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 378.38Molecular Weight (Monoisotopic): 378.0686AlogP: 2.02#Rotatable Bonds: 4Polar Surface Area: 107.72Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.27CX Basic pKa: ┄CX LogP: 1.63CX LogD: 1.63Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.79Np Likeness Score: -0.92
References 1. al-Rashida M, Batool G, Sattar A, Ejaz SA, Khan S, Lecka J, Sévigny J, Hameed A, Iqbal J.. (2016) 2-Alkoxy-3-(sulfonylarylaminomethylene)-chroman-4-ones as potent and selective inhibitors of ectonucleotidases., 115 [PMID:27054295 ] [10.1016/j.ejmech.2016.02.073 ]