Dimethyl-carbamic acid 3-{[4-dimethylamino-1-(5,6,7,8-tetrahydro-cyclopenta[4,5]pyrrolo[2,3-d]pyrimidin-4-yl)-piperidine-4-carbonyl]-amino}-phenyl ester

ID: ALA3797634

PubChem CID: 127047687

Max Phase: Preclinical

Molecular Formula: C26H33N7O3

Molecular Weight: 491.60

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)C(=O)Oc1cccc(NC(=O)C2(N(C)C)CCN(c3ncnc4[nH]c5c(c34)CCC5)CC2)c1

Standard InChI:  InChI=1S/C26H33N7O3/c1-31(2)25(35)36-18-8-5-7-17(15-18)29-24(34)26(32(3)4)11-13-33(14-12-26)23-21-19-9-6-10-20(19)30-22(21)27-16-28-23/h5,7-8,15-16H,6,9-14H2,1-4H3,(H,29,34)(H,27,28,30)

Standard InChI Key:  FQQRNYQTYDWOME-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   -3.6810    1.1807    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1672    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1485   -1.3659    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2225    1.5280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2039    0.3704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6669   -1.0186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4399   -1.9215    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7680    2.9582    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7622    4.0803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2873    5.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8176    5.8032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1771    4.6805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2978    3.2576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8265    6.8871    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6398    6.0636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0196    7.2019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6355    4.9406    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1061    5.2406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1029    4.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5720    4.4225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0444    5.8462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0476    6.9671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5785    6.6643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3010    0.3704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7408   -1.0186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2688   -1.0186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7318    0.3704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5048    1.2733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4474    8.0257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0021    6.6465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5717    3.3030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0412    3.6081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0408    2.4886    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4171    4.7477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2158    2.7325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6649    1.3490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7 25  1  0
 24  5  1  0
  4  8  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 11 14  1  0
 11 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 24  1  0
 14 29  1  0
 14 30  1  0
 20 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  2  0
 33 35  1  0
 33 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3797634

    ---

Associated Targets(Human)

LIMK2 Tchem LIM domain kinase 2 (949 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Plasma (7708 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 491.60Molecular Weight (Monoisotopic): 491.2645AlogP: 3.05#Rotatable Bonds: 5
Polar Surface Area: 106.69Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.82CX Basic pKa: 7.82CX LogP: 2.88CX LogD: 2.31
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.56Np Likeness Score: -1.21

References

1. Alen J, Bourin A, Boland S, Geraets J, Schroeders P, Defert O.  (2016)  Tetrahydro-pyrimido-indoles as selective LIMK inhibitors: synthesis, selectivity profiling and structureactivity studies,  (3): [10.1039/C5MD00473J]

Source