The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(1-(6,6-difluoro-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-yl)-4-(dimethylamino)piperidine-4-carboxamido)phenyl dimethylcarbamate ID: ALA3797658
PubChem CID: 127047688
Max Phase: Preclinical
Molecular Formula: C27H33F2N7O3
Molecular Weight: 541.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)C(=O)Oc1cccc(NC(=O)C2(N(C)C)CCN(c3ncnc4[nH]c5c(c34)CC(F)(F)CC5)CC2)c1
Standard InChI: InChI=1S/C27H33F2N7O3/c1-34(2)25(38)39-18-7-5-6-17(14-18)32-24(37)26(35(3)4)10-12-36(13-11-26)23-21-19-15-27(28,29)9-8-20(19)33-22(21)30-16-31-23/h5-7,14,16H,8-13,15H2,1-4H3,(H,32,37)(H,30,31,33)
Standard InChI Key: PUQNSBRQHFAIKU-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
-3.7006 0.8244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.7006 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4915 -1.3190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4915 1.5389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2274 0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2274 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.3190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5059 3.0395 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8107 3.7796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8223 5.2795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5291 6.0395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2243 5.2996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2127 3.7996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8347 6.7382 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2347 6.7580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2441 7.9579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0712 6.0182 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3652 6.7784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6714 6.0409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9633 6.8032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9489 8.3032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6428 9.0407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3510 8.2783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8449 7.9382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8690 6.1298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2716 6.0680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5631 6.8326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8715 6.0973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5495 8.0325 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9040 6.7087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8850 4.8974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2274 0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2274 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4732 -1.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7372 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7372 0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4732 1.5389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7039 2.0239 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.7652 0.2052 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 33 1 0
32 5 1 0
4 8 1 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
11 14 1 0
11 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
14 24 1 0
14 25 1 0
20 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
28 31 1 0
32 33 2 0
32 37 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
36 38 1 0
36 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 541.60Molecular Weight (Monoisotopic): 541.2613AlogP: 3.68#Rotatable Bonds: 5Polar Surface Area: 106.69Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.78CX Basic pKa: 7.82CX LogP: 2.81CX LogD: 2.24Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.51Np Likeness Score: -1.00
References 1. Alen J, Bourin A, Boland S, Geraets J, Schroeders P, Defert O. (2016) Tetrahydro-pyrimido-indoles as selective LIMK inhibitors: synthesis, selectivity profiling and structureactivity studies, 7 (3): [10.1039/C5MD00473J ]