N-tert-butyl-2-(4-chlorophenyl)-2-(4-oxo-1,2,4,5-tetrahydroazepino[4,5-b]indol-3(6H)-yl)acetamide

ID: ALA3797813

PubChem CID: 127046451

Max Phase: Preclinical

Molecular Formula: C24H26ClN3O2

Molecular Weight: 423.94

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(C)NC(=O)C(c1ccc(Cl)cc1)N1CCc2c([nH]c3ccccc23)CC1=O

Standard InChI:  InChI=1S/C24H26ClN3O2/c1-24(2,3)27-23(30)22(15-8-10-16(25)11-9-15)28-13-12-18-17-6-4-5-7-19(17)26-20(18)14-21(28)29/h4-11,22,26H,12-14H2,1-3H3,(H,27,30)

Standard InChI Key:  NAYOZXVQLJRKTB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   -2.7122    3.6879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2001    2.1854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1854    1.0927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2488    4.0196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2342    2.9074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7025    1.4634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5073    0.6244    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6976    1.5220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2488    2.9074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0878    4.1757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0830    0.9756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5903    4.2733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3903    1.7366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6050    3.1610    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0481    3.5816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4078    5.0386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5425    5.8700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8493    5.4565    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1325    2.5439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7763    1.0866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8600    0.0496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3000    0.4696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6563    1.9266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5726    2.9637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1670   -0.3601    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.3830    1.0624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2091    6.9136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3616    7.2477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3437    7.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4962    8.0787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  9  5  1  0
  8  9  2  0
  9 10  1  0
  8 11  1  0
 10 12  1  0
 11 13  1  0
 12 14  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 16 18  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 15 19  1  0
 22 25  1  0
 13 26  2  0
 18 27  1  0
 27 28  1  0
 27 29  1  0
 27 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3797813

    ---

Associated Targets(non-human)

Htr6 Serotonin 6 (5-HT6) receptor (86 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 423.94Molecular Weight (Monoisotopic): 423.1714AlogP: 4.40#Rotatable Bonds: 3
Polar Surface Area: 65.20Molecular Species: NEUTRALHBA: 2HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.80CX LogD: 3.80
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.66Np Likeness Score: -0.88

References

1. Rentería-Gómez A, Islas-Jácome A, Díaz-Cervantes E, Villaseñor-Granados T, Robles J, Gámez-Montaño R..  (2016)  Synthesis of azepino[4,5-b]indol-4-ones via MCR/free radical cyclization and in vitro-in silico studies as 5-Ht₆R ligands.,  26  (9): [PMID:26996373] [10.1016/j.bmcl.2016.03.036]

Source