3-(7-(2-fluorophenyl)-2-((2-methyl-2H-1,2,4-triazol-3-yl)methoxy)pyrazolo[1,5-d][1,2,4]triazin-3-yl)benzenamine

ID: ALA379788

PubChem CID: 18406880

Max Phase: Preclinical

Molecular Formula: C21H17FN8O

Molecular Weight: 416.42

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cn1ncnc1COc1nn2c(-c3ccccc3F)nncc2c1-c1cccc(N)c1

Standard InChI:  InChI=1S/C21H17FN8O/c1-29-18(24-12-26-29)11-31-21-19(13-5-4-6-14(23)9-13)17-10-25-27-20(30(17)28-21)15-7-2-3-8-16(15)22/h2-10,12H,11,23H2,1H3

Standard InChI Key:  BJWCHPTVHBYZPV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
    6.2682  -22.1824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4517  -22.3264    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3345  -23.1431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0751  -23.5069    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6498  -22.9149    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4662  -23.0343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9748  -17.9084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4060  -18.7356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4028  -17.9045    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6846  -17.4957    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6865  -19.1491    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9721  -18.7330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3555  -19.2838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6890  -20.0404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5115  -19.9571    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2737  -20.7534    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6396  -18.8743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6424  -18.0520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9274  -17.6418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2132  -18.0567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2185  -18.8860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9340  -19.2925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1208  -19.1475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1195  -19.9724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8336  -20.3842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5486  -19.9710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5452  -19.1416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8306  -18.7335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8269  -17.9084    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.6835  -21.4695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5067  -19.3034    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
 15 11  1  0
  2  3  1  0
 14 16  1  0
 11  8  1  0
 13 17  1  0
  3  4  2  0
 17 18  2  0
  8  9  2  0
 18 19  1  0
  4  5  1  0
 19 20  2  0
  9 10  1  0
 20 21  1  0
 10  7  2  0
 21 22  2  0
 22 17  1  0
 11 12  1  0
  8 23  1  0
  5  1  1  0
 23 24  2  0
 24 25  1  0
  5  6  1  0
 25 26  2  0
  1  2  2  0
 26 27  1  0
  7 12  1  0
 27 28  2  0
 28 23  1  0
 12 13  2  0
 28 29  1  0
 13 14  1  0
 16 30  1  0
 30  1  1  0
 14 15  2  0
 21 31  1  0
M  END

Associated Targets(Human)

GABRG2 Tclin GABA-A receptor; alpha-3/beta-3/gamma-2 (1250 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GABRA1 Tclin GABA-A receptor; alpha-1/beta-3/gamma-2 (1565 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 416.42Molecular Weight (Monoisotopic): 416.1509AlogP: 2.89#Rotatable Bonds: 5
Polar Surface Area: 109.04Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.42CX LogP: 2.29CX LogD: 2.29
Aromatic Rings: 5Heavy Atoms: 31QED Weighted: 0.44Np Likeness Score: -1.61

References

1. Carling RW, Russell MG, Moore KW, Mitchinson A, Guiblin A, Smith A, Wafford KA, Marshall G, Atack JR, Street LJ..  (2006)  2,3,7-Trisubstituted pyrazolo[1,5-d][1,2,4]triazines: functionally selective GABAA alpha3-subtype agonists.,  16  (13): [PMID:16621541] [10.1016/j.bmcl.2006.03.081]

Source