2-cyclohexyl-N-(2,6-dimethylphenyl)-2-(4-oxo-1,4,5,6-tetrahydroazepino[4,5-b]indol-3(2H)-yl)acetamide

ID: ALA3797890

PubChem CID: 127048033

Max Phase: Preclinical

Molecular Formula: C28H33N3O2

Molecular Weight: 443.59

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(C)c1NC(=O)C(C1CCCCC1)N1CCc2c([nH]c3ccccc23)CC1=O

Standard InChI:  InChI=1S/C28H33N3O2/c1-18-9-8-10-19(2)26(18)30-28(33)27(20-11-4-3-5-12-20)31-16-15-22-21-13-6-7-14-23(21)29-24(22)17-25(31)32/h6-10,13-14,20,27,29H,3-5,11-12,15-17H2,1-2H3,(H,30,33)

Standard InChI Key:  DFYAZARZVNKUBL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
    6.4077    5.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0484    3.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5421    5.8686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8491    5.4559    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5073    0.6244    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6976    1.5220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2488    2.9074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2342    2.9074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2488    4.0196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7122    3.6879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2001    2.1854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1854    1.0927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7025    1.4634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6050    3.1610    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3903    1.7366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0830    0.9756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0878    4.1757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5903    4.2733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3830    1.0624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2084    6.9131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6484    7.3333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0045    8.7904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9207    9.8274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4807    9.4072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1246    7.9501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9726    7.6141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5154    6.5037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1310    2.5410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5723    2.9569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6531    1.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2927    0.4607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8515    0.0447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7707    1.0849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  1  4  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
  5 13  1  0
  8 13  2  0
 14 15  1  0
 15 16  1  0
 17 18  1  0
 14 18  1  0
  6 16  1  0
  7 17  1  0
 15 19  2  0
  2 14  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 20 25  2  0
 25 26  1  0
 21 27  1  0
  4 20  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 28 33  1  0
  2 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3797890

    ---

Associated Targets(non-human)

Htr6 Serotonin 6 (5-HT6) receptor (86 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 443.59Molecular Weight (Monoisotopic): 443.2573AlogP: 5.30#Rotatable Bonds: 4
Polar Surface Area: 65.20Molecular Species: NEUTRALHBA: 2HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.59CX Basic pKa: CX LogP: 5.58CX LogD: 5.58
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.57Np Likeness Score: -0.49

References

1. Rentería-Gómez A, Islas-Jácome A, Díaz-Cervantes E, Villaseñor-Granados T, Robles J, Gámez-Montaño R..  (2016)  Synthesis of azepino[4,5-b]indol-4-ones via MCR/free radical cyclization and in vitro-in silico studies as 5-Ht₆R ligands.,  26  (9): [PMID:26996373] [10.1016/j.bmcl.2016.03.036]

Source