The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 2-(3-(4-(aminomethyl)-1-(6,6-difluoro-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-yl)piperidine-4-carboxamido)phenyl)acetate ID: ALA3798412
PubChem CID: 127046991
Max Phase: Preclinical
Molecular Formula: C26H30F2N6O3
Molecular Weight: 512.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)Cc1cccc(NC(=O)C2(CN)CCN(c3ncnc4[nH]c5c(c34)CC(F)(F)CC5)CC2)c1
Standard InChI: InChI=1S/C26H30F2N6O3/c1-37-20(35)12-16-3-2-4-17(11-16)32-24(36)25(14-29)7-9-34(10-8-25)23-21-18-13-26(27,28)6-5-19(18)33-22(21)30-15-31-23/h2-4,11,15H,5-10,12-14,29H2,1H3,(H,32,36)(H,30,31,33)
Standard InChI Key: GBGCCWYYTLPKCJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
-3.7006 0.8244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.7006 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4915 -1.3190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4915 1.5389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2274 0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2274 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.3190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5059 3.0395 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8107 3.7796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8223 5.2795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5291 6.0395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2243 5.2996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2127 3.7996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8347 6.7382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2347 6.7580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2441 7.9579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0712 6.0182 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3652 6.7784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6714 6.0409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9633 6.8032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9489 8.3032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6428 9.0407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3510 8.2783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2274 0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2274 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4732 -1.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7372 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7372 0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4732 1.5389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7039 2.0239 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.7652 0.2052 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.2716 6.0680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5631 6.8326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8715 6.0973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5495 8.0325 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9040 6.7087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8449 7.9382 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 25 1 0
24 5 1 0
4 8 1 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
11 14 1 0
11 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
24 25 2 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
28 31 1 0
20 32 1 0
32 33 1 0
33 34 1 0
33 35 2 0
34 36 1 0
14 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 512.56Molecular Weight (Monoisotopic): 512.2347AlogP: 2.98#Rotatable Bonds: 6Polar Surface Area: 126.23Molecular Species: BASEHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.46CX Basic pKa: 9.16CX LogP: 2.38CX LogD: 0.62Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.43Np Likeness Score: -0.70
References 1. Alen J, Bourin A, Boland S, Geraets J, Schroeders P, Defert O. (2016) Tetrahydro-pyrimido-indoles as selective LIMK inhibitors: synthesis, selectivity profiling and structureactivity studies, 7 (3): [10.1039/C5MD00473J ]