3-((4-chlorophenyl)(1-(2,6-dimethylphenyl)-1H-tetrazol-5-yl)methyl)-2,3,5,6-tetrahydroazepino[4,5-b]indol-4(1H)-one

ID: ALA3799028

PubChem CID: 72696314

Max Phase: Preclinical

Molecular Formula: C28H25ClN6O

Molecular Weight: 497.00

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(C)c1-n1nnnc1C(c1ccc(Cl)cc1)N1CCc2c([nH]c3ccccc23)CC1=O

Standard InChI:  InChI=1S/C28H25ClN6O/c1-17-6-5-7-18(2)26(17)35-28(31-32-33-35)27(19-10-12-20(29)13-11-19)34-15-14-22-21-8-3-4-9-23(21)30-24(22)16-25(34)36/h3-13,27,30H,14-16H2,1-2H3

Standard InChI Key:  UQDQCTIWJVHADE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
   -1.7010    0.6501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6455   -0.9286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3183   -1.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4392    1.4623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8946    0.7642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9484   -0.7528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3722   -1.1275    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1837    0.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2882    1.2714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6428    2.7502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6724    0.0835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0213    3.3557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6407    1.2457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3552    2.6576    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8041    0.9517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5687    3.5445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4076    5.0366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7926    5.5784    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6868    7.0747    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2311    7.4364    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4372    6.1637    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9411    2.9371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1043    1.4459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4772    0.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6870    1.7285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5239    3.2196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1510    3.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7853    1.2451    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.9918    6.5677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8446    5.6095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4365    6.1267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1804    7.6046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3323    8.5654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7403    8.0483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6631    8.8154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0498    4.4272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  9  5  1  0
  8  9  2  0
  9 10  1  0
  8 11  1  0
 10 12  1  0
 11 13  1  0
 12 14  1  0
 13 14  1  0
 13 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 17  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 16 22  1  0
 25 28  1  0
 21 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 34 35  1  0
 30 36  1  0
M  END

Associated Targets(non-human)

Htr6 Serotonin 6 (5-HT6) receptor (86 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 497.00Molecular Weight (Monoisotopic): 496.1778AlogP: 5.13#Rotatable Bonds: 4
Polar Surface Area: 79.70Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.71CX LogD: 5.71
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.37Np Likeness Score: -1.19

References

1. Rentería-Gómez A, Islas-Jácome A, Díaz-Cervantes E, Villaseñor-Granados T, Robles J, Gámez-Montaño R..  (2016)  Synthesis of azepino[4,5-b]indol-4-ones via MCR/free radical cyclization and in vitro-in silico studies as 5-Ht₆R ligands.,  26  (9): [PMID:26996373] [10.1016/j.bmcl.2016.03.036]

Source