N-(3-(1,2,4-oxadiazol-5-yl)phenyl)-4-(dimethylamino)-1-(6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-yl)piperidine-4-carboxamide

ID: ALA3799318

PubChem CID: 127047686

Max Phase: Preclinical

Molecular Formula: C26H30N8O2

Molecular Weight: 486.58

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)C1(C(=O)Nc2cccc(-c3ncno3)c2)CCN(c2ncnc3[nH]c4c(c23)CCCC4)CC1

Standard InChI:  InChI=1S/C26H30N8O2/c1-33(2)26(25(35)31-18-7-5-6-17(14-18)24-29-16-30-36-24)10-12-34(13-11-26)23-21-19-8-3-4-9-20(19)32-22(21)27-15-28-23/h5-7,14-16H,3-4,8-13H2,1-2H3,(H,31,35)(H,27,28,32)

Standard InChI Key:  GNHKGIMYNFCSPS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
   -3.7006    0.8244    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7006   -0.6045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4915   -1.3190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4915    1.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2274    0.8244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2274   -0.6045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.3190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5059    3.0395    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8107    3.7796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8223    5.2795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5291    6.0395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2243    5.2996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2127    3.7996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8347    6.7382    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2347    6.7580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2441    7.9579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0712    6.0182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3652    6.7784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6714    6.0409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9633    6.8032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9489    8.3032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6428    9.0407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3510    8.2783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2274    0.8244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2274   -0.6045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4732   -1.3190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7372   -0.6045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7372    0.8244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4732    1.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8449    7.9382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8690    6.1298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2701    6.0653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4244    4.5861    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8950    4.2906    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6305    5.5979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6145    6.7013    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7 25  1  0
 24  5  1  0
  4  8  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 11 14  1  0
 11 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 24 25  2  0
 24 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 14 30  1  0
 14 31  1  0
 32 33  1  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 32  2  0
 20 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3799318

    ---

Associated Targets(Human)

LIMK2 Tchem LIM domain kinase 2 (949 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 486.58Molecular Weight (Monoisotopic): 486.2492AlogP: 3.43#Rotatable Bonds: 5
Polar Surface Area: 116.07Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.90CX Basic pKa: 7.88CX LogP: 3.30CX LogD: 2.74
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.44Np Likeness Score: -1.16

References

1. Alen J, Bourin A, Boland S, Geraets J, Schroeders P, Defert O.  (2016)  Tetrahydro-pyrimido-indoles as selective LIMK inhibitors: synthesis, selectivity profiling and structureactivity studies,  (3): [10.1039/C5MD00473J]

Source