The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-Hydroxy-5-[2-[[3-methoxy-4-(3-phenylpropoxy)phenethyl]amino]ethyl]quinolin-2(1H)-one ID: ALA3799455
PubChem CID: 127046949
Max Phase: Preclinical
Molecular Formula: C29H32N2O4
Molecular Weight: 472.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(CCNCCc2ccc(O)c3[nH]c(=O)ccc23)ccc1OCCCc1ccccc1
Standard InChI: InChI=1S/C29H32N2O4/c1-34-27-20-22(9-13-26(27)35-19-5-8-21-6-3-2-4-7-21)15-17-30-18-16-23-10-12-25(32)29-24(23)11-14-28(33)31-29/h2-4,6-7,9-14,20,30,32H,5,8,15-19H2,1H3,(H,31,33)
Standard InChI Key: ROTBWFGDDNEYCJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6486 1.3517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2995 -2.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -3.7467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6034 -5.2475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9042 -5.9961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9073 -7.4969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2082 -8.2455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2134 -9.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5151 -10.4910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8115 -9.7365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8063 -8.2365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5047 -7.4910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1154 -10.4797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4114 -9.7230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7153 -10.4662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0114 -9.7095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3153 -10.4527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6118 -9.6982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9134 -10.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9186 -11.9437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6222 -12.6982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3206 -11.9527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5172 -11.9918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4792 -12.5939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 2.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
1 10 1 0
5 10 2 0
2 11 2 0
12 13 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
17 22 2 0
24 25 1 0
25 26 1 0
23 24 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
27 32 2 0
26 27 1 0
20 23 1 0
33 34 1 0
19 33 1 0
14 15 1 0
13 14 1 0
6 12 1 0
9 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 472.59Molecular Weight (Monoisotopic): 472.2362AlogP: 4.63#Rotatable Bonds: 12Polar Surface Area: 83.58Molecular Species: BASEHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.85CX Basic pKa: 10.27CX LogP: 4.18CX LogD: 2.96Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.26Np Likeness Score: 0.07
References 1. Weichert D, Stanek M, Hübner H, Gmeiner P.. (2016) Structure-guided development of dual β2 adrenergic/dopamine D2 receptor agonists., 24 (12): [PMID:27132867 ] [10.1016/j.bmc.2016.04.028 ]