The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(dimethylamino)-N-(3-(oxazol-5-yl)phenyl)-1-(6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-yl)piperidine-4-carboxamide ID: ALA3799695
PubChem CID: 127045880
Max Phase: Preclinical
Molecular Formula: C27H31N7O2
Molecular Weight: 485.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)C1(C(=O)Nc2cccc(-c3cnco3)c2)CCN(c2ncnc3[nH]c4c(c23)CCCC4)CC1
Standard InChI: InChI=1S/C27H31N7O2/c1-33(2)27(26(35)31-19-7-5-6-18(14-19)22-15-28-17-36-22)10-12-34(13-11-27)25-23-20-8-3-4-9-21(20)32-24(23)29-16-30-25/h5-7,14-17H,3-4,8-13H2,1-2H3,(H,31,35)(H,29,30,32)
Standard InChI Key: UJCLBWBWMXJXCM-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
-3.7006 0.8244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.7006 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4915 -1.3190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4915 1.5389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2274 0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2274 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.3190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5059 3.0395 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8107 3.7796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8223 5.2795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5291 6.0395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2243 5.2996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2127 3.7996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8347 6.7382 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2347 6.7580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2441 7.9579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0712 6.0182 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3652 6.7784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6714 6.0409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9633 6.8032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9489 8.3032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6428 9.0407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3510 8.2783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2274 0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2274 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4732 -1.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7372 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7372 0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4732 1.5389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8449 7.9382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8690 6.1298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2701 6.0653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4244 4.5861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8950 4.2906 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6305 5.5979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6145 6.7013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 25 1 0
24 5 1 0
4 8 1 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
11 14 1 0
11 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
24 25 2 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
14 30 1 0
14 31 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 32 1 0
20 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.59Molecular Weight (Monoisotopic): 485.2539AlogP: 4.03#Rotatable Bonds: 5Polar Surface Area: 103.18Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.98CX Basic pKa: 7.89CX LogP: 3.11CX LogD: 2.53Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.44Np Likeness Score: -1.24
References 1. Alen J, Bourin A, Boland S, Geraets J, Schroeders P, Defert O. (2016) Tetrahydro-pyrimido-indoles as selective LIMK inhibitors: synthesis, selectivity profiling and structureactivity studies, 7 (3): [10.1039/C5MD00473J ]