The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-chlorophenyl)-N-(2,6-dimethylphenyl)-2-(4-oxo-1,4,5,6-tetrahydroazepino[4,5-b]indol-3(2H)-yl)acetamide ID: ALA3800049
PubChem CID: 127046453
Max Phase: Preclinical
Molecular Formula: C28H26ClN3O2
Molecular Weight: 471.99
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccc(C)c1NC(=O)C(c1ccc(Cl)cc1)N1CCc2c([nH]c3ccccc23)CC1=O
Standard InChI: InChI=1S/C28H26ClN3O2/c1-17-6-5-7-18(2)26(17)31-28(34)27(19-10-12-20(29)13-11-19)32-15-14-22-21-8-3-4-9-23(21)30-24(22)16-25(32)33/h3-13,27,30H,14-16H2,1-2H3,(H,31,34)
Standard InChI Key: JGULJSGDGBKDOE-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
6.4076 5.0366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0486 3.5794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5602 5.3703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3256 6.0768 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5073 0.6244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6976 1.5220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2488 2.9074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2342 2.9074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2488 4.0196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7122 3.6879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2001 2.1854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1854 1.0927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7025 1.4634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6050 3.1610 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3903 1.7366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0830 0.9756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0878 4.1757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5903 4.2733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3830 1.0624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6846 7.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6048 8.5753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9665 10.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4080 10.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4879 9.4045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1262 7.9488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9901 7.1159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4515 8.2436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1305 2.5392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7739 1.0822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8573 0.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2975 0.4643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6542 1.9213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5707 2.9587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1642 -0.3656 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
5 13 1 0
8 13 2 0
14 15 1 0
15 16 1 0
17 18 1 0
14 18 1 0
6 16 1 0
7 17 1 0
15 19 2 0
2 14 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
20 25 2 0
25 26 1 0
21 27 1 0
4 20 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
28 33 2 0
31 34 1 0
2 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.99Molecular Weight (Monoisotopic): 471.1714AlogP: 5.75#Rotatable Bonds: 4Polar Surface Area: 65.20Molecular Species: NEUTRALHBA: 2HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.40CX Basic pKa: ┄CX LogP: 5.79CX LogD: 5.79Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.40Np Likeness Score: -0.97
References 1. Rentería-Gómez A, Islas-Jácome A, Díaz-Cervantes E, Villaseñor-Granados T, Robles J, Gámez-Montaño R.. (2016) Synthesis of azepino[4,5-b]indol-4-ones via MCR/free radical cyclization and in vitro-in silico studies as 5-Ht₆R ligands., 26 (9): [PMID:26996373 ] [10.1016/j.bmcl.2016.03.036 ]