The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-(((3,5-difluorophenyl)(2-methoxyethyl)amino)methyl)-N,N-dimethyl-2-morpholino-4-oxo-4H-chromene-6-carboxamide ID: ALA3800314
PubChem CID: 127045875
Max Phase: Preclinical
Molecular Formula: C26H29F2N3O5
Molecular Weight: 501.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COCCN(Cc1cc(C(=O)N(C)C)cc2c(=O)cc(N3CCOCC3)oc12)c1cc(F)cc(F)c1
Standard InChI: InChI=1S/C26H29F2N3O5/c1-29(2)26(33)17-10-18(16-31(4-7-34-3)21-13-19(27)12-20(28)14-21)25-22(11-17)23(32)15-24(36-25)30-5-8-35-9-6-30/h10-15H,4-9,16H2,1-3H3
Standard InChI Key: IJKVNSWSGUDBLV-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 2.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8926 -1.4990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1929 -0.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4908 -1.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4885 -3.0029 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1883 -3.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8904 -2.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9091 1.5019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9494 0.9039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9067 3.0027 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2906 -2.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 -3.7544 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5811 -5.2553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8884 -3.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2812 -6.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2795 -7.5038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5777 -8.2553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8776 -7.5068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8793 -6.0068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2396 -8.1027 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.9161 -8.1080 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.9447 3.6050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8664 3.6008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8927 -1.5061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1941 -0.7585 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.1975 0.4415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
12 13 1 0
12 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
8 12 1 0
1 18 1 0
18 19 2 0
18 20 1 0
3 21 1 0
21 22 1 0
22 23 1 0
22 24 1 0
23 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 23 1 0
26 30 1 0
28 31 1 0
20 32 1 0
20 33 1 0
24 34 1 0
34 35 1 0
35 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.53Molecular Weight (Monoisotopic): 501.2075AlogP: 3.26#Rotatable Bonds: 8Polar Surface Area: 75.46Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.13CX LogD: 3.13Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.47Np Likeness Score: -1.00
References 1. Barlaam B, Cosulich S, Degorce S, Fitzek M, Green S, Hancox U, Lambert-van der Brempt C, Lohmann JJ, Maudet M, Morgentin R, Péru A, Plé P, Saleh T, Ward L, Warin N.. (2016) Discovery of a series of 8-(2,3-dihydro-1,4-benzoxazin-4-ylmethyl)-2-morpholino-4-oxo-chromene-6-carboxamides as PI3Kβ/δ inhibitors for the treatment of PTEN-deficient tumours., 26 (9): [PMID:26996374 ] [10.1016/j.bmcl.2016.03.034 ]