N-[(S)-3-(2-Ethyl-4-{5-[2-(1-ethyl-propyl)-6-methoxy-pyridin-4-yl]-1,2,4-oxadiazol-3-yl}-6-methyl-phenoxy)-2-hydroxy-propyl]-2-hydroxy-acetamide

ID: ALA3800336

PubChem CID: 49871977

Max Phase: Preclinical

Molecular Formula: C27H36N4O6

Molecular Weight: 512.61

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1cc(-c2noc(-c3cc(OC)nc(C(CC)CC)c3)n2)cc(C)c1OC[C@@H](O)CNC(=O)CO

Standard InChI:  InChI=1S/C27H36N4O6/c1-6-17(7-2)22-11-20(12-24(29-22)35-5)27-30-26(31-37-27)19-9-16(4)25(18(8-3)10-19)36-15-21(33)13-28-23(34)14-32/h9-12,17,21,32-33H,6-8,13-15H2,1-5H3,(H,28,34)/t21-/m0/s1

Standard InChI Key:  WIAYBOGKYOFFEX-NRFANRHFSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
    5.1873   -7.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4855   -8.2648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1470   -8.1099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1894   -6.0109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4838   -9.4648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8912   -5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9336   -3.1588    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2067    3.2905    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7390    2.9810    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5987    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9492    0.8772    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9546    1.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6524    0.4669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1531    0.5134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4469    1.8311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2337    3.1102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7329    3.0637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.4423    1.7421    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -9.5259    4.3380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -10.7253    4.2991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.3649   -0.8540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.8651   -0.8984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.4348   -1.9546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5794   -2.1329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1503   -3.1884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5972    1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5955    2.7031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  1  4  1  0
  2  5  1  0
  6  7  1  0
  7  8  1  0
  7  9  1  1
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 11 16  2  0
 10 11  1  0
 16 17  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 18 22  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 23 28  2  0
 29 30  1  0
 27 29  1  0
 31 32  1  0
 32 33  1  0
 34 35  1  0
 31 34  1  0
 23 31  1  0
 22 25  1  0
 14 20  1  0
 36 37  1  0
 12 36  1  0
  8 10  1  0
  4  6  1  0
M  END

Associated Targets(Human)

S1PR3 Tclin Sphingosine 1-phosphate receptor Edg-3 (2543 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
S1PR1 Tclin Sphingosine 1-phosphate receptor Edg-1 (5806 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Plasma (10718 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Trachea (249 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 512.61Molecular Weight (Monoisotopic): 512.2635AlogP: 3.43#Rotatable Bonds: 13
Polar Surface Area: 139.83Molecular Species: NEUTRALHBA: 9HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.41CX Basic pKa: 1.62CX LogP: 4.49CX LogD: 4.49
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.31Np Likeness Score: -0.66

References

1. Bolli MH, Lescop C, Birker M, de Kanter R, Hess P, Kohl C, Nayler O, Rey M, Sieber P, Velker J, Weller T, Steiner B..  (2016)  Novel S1P1 receptor agonists - Part 5: From amino-to alkoxy-pyridines.,  115  [PMID:27027817] [10.1016/j.ejmech.2016.03.020]
2. Dyckman AJ..  (2017)  Modulators of Sphingosine-1-phosphate Pathway Biology: Recent Advances of Sphingosine-1-phosphate Receptor 1 (S1P1) Agonists and Future Perspectives.,  60  (13): [PMID:28291340] [10.1021/acs.jmedchem.6b01575]

Source