(S)-N-(3-(2-Ethyl-4-(5-(2-methoxy-6-phenylpyridin-4-yl)-1,2,4-oxadiazol-3-yl)-6-methylphenoxy)-2-hydroxypropyl)-2-hydroxyacetamide

ID: ALA3800496

PubChem CID: 127046183

Max Phase: Preclinical

Molecular Formula: C28H30N4O6

Molecular Weight: 518.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1cc(-c2noc(-c3cc(OC)nc(-c4ccccc4)c3)n2)cc(C)c1OC[C@@H](O)CNC(=O)CO

Standard InChI:  InChI=1S/C28H30N4O6/c1-4-18-11-20(10-17(2)26(18)37-16-22(34)14-29-24(35)15-33)27-31-28(38-32-27)21-12-23(30-25(13-21)36-3)19-8-6-5-7-9-19/h5-13,22,33-34H,4,14-16H2,1-3H3,(H,29,35)/t22-/m0/s1

Standard InChI Key:  PEONWNSYYVEVSO-QFIPXVFZSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
    5.1873   -7.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4855   -8.2648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1470   -8.1099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1894   -6.0109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4838   -9.4648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8912   -5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9336   -3.1588    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2067    3.2905    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7390    2.9810    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5987    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9492    0.8772    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9546    1.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6524    0.4669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1531    0.5134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4469    1.8311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2337    3.1102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7329    3.0637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.4423    1.7421    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -9.5232    4.3395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8160    5.6624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.6079    6.9363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.1071    6.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.8144    5.5647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.0225    4.2908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.3649   -0.8540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -10.5644   -0.8895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5972    1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5955    2.7031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  1  4  1  0
  2  5  1  0
  6  7  1  0
  7  8  1  0
  7  9  1  1
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 11 16  2  0
 10 11  1  0
 16 17  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 18 22  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 23 28  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 29 34  2  0
 27 29  1  0
 35 36  1  0
 23 35  1  0
 22 25  1  0
 14 20  1  0
 37 38  1  0
 12 37  1  0
  8 10  1  0
  4  6  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3800496

    ---

Associated Targets(Human)

S1PR3 Tclin Sphingosine 1-phosphate receptor Edg-3 (2543 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
S1PR1 Tclin Sphingosine 1-phosphate receptor Edg-1 (5806 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 518.57Molecular Weight (Monoisotopic): 518.2165AlogP: 3.19#Rotatable Bonds: 11
Polar Surface Area: 139.83Molecular Species: NEUTRALHBA: 9HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.41CX Basic pKa: 0.72CX LogP: 4.31CX LogD: 4.31
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.27Np Likeness Score: -0.95

References

1. Bolli MH, Lescop C, Birker M, de Kanter R, Hess P, Kohl C, Nayler O, Rey M, Sieber P, Velker J, Weller T, Steiner B..  (2016)  Novel S1P1 receptor agonists - Part 5: From amino-to alkoxy-pyridines.,  115  [PMID:27027817] [10.1016/j.ejmech.2016.03.020]

Source