The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 3-(5-(4-(piperidin-1-yl)piperidin-1-yl)-1H-benzo[d]imidazol-2-yl)-1H-indazole-5-carboxylate ID: ALA380372
PubChem CID: 136043801
Max Phase: Preclinical
Molecular Formula: C26H30N6O2
Molecular Weight: 458.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccc2[nH]nc(-c3nc4cc(N5CCC(N6CCCCC6)CC5)ccc4[nH]3)c2c1
Standard InChI: InChI=1S/C26H30N6O2/c1-34-26(33)17-5-7-21-20(15-17)24(30-29-21)25-27-22-8-6-19(16-23(22)28-25)32-13-9-18(10-14-32)31-11-3-2-4-12-31/h5-8,15-16,18H,2-4,9-14H2,1H3,(H,27,28)(H,29,30)
Standard InChI Key: HUQYQFBIFGUUQQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
-4.7548 -5.1734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7618 -6.0006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0520 -6.4183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0426 -4.7657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3276 -5.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3327 -6.0059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5481 -6.2662 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0581 -5.6005 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5398 -4.9288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2801 -4.1461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4941 -3.9008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7604 -3.4806 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2717 -2.8165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4892 -3.0803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8716 -2.5350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0352 -1.7259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8220 -1.4649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4363 -2.0119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9887 -0.6573 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3655 -0.1092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5295 0.6953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3113 0.9589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9294 0.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7657 -0.3993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4750 1.7671 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8545 2.3074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0155 3.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7963 3.3790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4164 2.8340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2559 2.0226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4664 -4.7568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4636 -3.9322 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.1852 -5.1648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.7480 -3.5224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15 16 1 0
6 7 1 0
16 17 2 0
7 8 1 0
17 18 1 0
18 13 2 0
8 9 2 0
17 19 1 0
19 20 1 0
9 5 1 0
4 1 2 0
9 10 1 0
10 11 1 0
5 6 2 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
22 25 1 0
25 26 1 0
11 14 1 0
13 12 1 0
12 10 2 0
2 3 2 0
3 6 1 0
25 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
13 14 1 0
1 31 1 0
1 2 1 0
14 15 2 0
31 32 1 0
31 33 2 0
5 4 1 0
32 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.57Molecular Weight (Monoisotopic): 458.2430AlogP: 4.35#Rotatable Bonds: 4Polar Surface Area: 90.14Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.68CX Basic pKa: 9.76CX LogP: 3.68CX LogD: 1.60Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.44Np Likeness Score: -1.18
References 1. McBride CM, Renhowe PA, Heise C, Jansen JM, Lapointe G, Ma S, Piñeda R, Vora J, Wiesmann M, Shafer CM.. (2006) Design and structure-activity relationship of 3-benzimidazol-2-yl-1H-indazoles as inhibitors of receptor tyrosine kinases., 16 (13): [PMID:16603352 ] [10.1016/j.bmcl.2006.03.069 ]