The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4'-cyano-5-(trifluoromethyl)-N-((3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-3-yl)biphenyl-3-carboxamide ID: ALA3804930
PubChem CID: 127048546
Max Phase: Preclinical
Molecular Formula: C21H19F3N2O6
Molecular Weight: 452.39
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1ccc(-c2cc(C(=O)N[C@H]3C(O)O[C@H](CO)[C@@H](O)[C@@H]3O)cc(C(F)(F)F)c2)cc1
Standard InChI: InChI=1S/C21H19F3N2O6/c22-21(23,24)14-6-12(11-3-1-10(8-25)2-4-11)5-13(7-14)19(30)26-16-18(29)17(28)15(9-27)32-20(16)31/h1-7,15-18,20,27-29,31H,9H2,(H,26,30)/t15-,16-,17-,18-,20?/m1/s1
Standard InChI Key: COPQJIWLCNSFTH-PCMBYBMQSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
2.3383 -1.3500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 -3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3421 -3.1476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 -5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6060 -6.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6060 -7.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 -8.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0080 -7.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0079 -6.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2917 -8.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2942 -9.7508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5944 -10.4988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8922 -9.7467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8899 -8.2467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5897 -7.4988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1931 -10.4951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2333 -11.0935 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9058 -8.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9454 -7.6513 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.9055 -9.4507 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.9448 -8.8511 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 -1.3500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 1.3500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0432 3.5994 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
7 6 1 0
2 7 1 0
7 8 1 6
8 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 11 2 0
15 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
20 23 1 0
23 24 3 0
13 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
6 29 1 1
5 30 1 6
4 31 1 1
32 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.39Molecular Weight (Monoisotopic): 452.1195AlogP: 0.77#Rotatable Bonds: 4Polar Surface Area: 143.04Molecular Species: NEUTRALHBA: 7HBD: 5#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.70CX Basic pKa: ┄CX LogP: 1.01CX LogD: 1.01Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.46Np Likeness Score: -0.09
References 1. Lin H, Zeng J, Xie R, Schulz MJ, Tedesco R, Qu J, Erhard KF, Mack JF, Raha K, Rendina AR, Szewczuk LM, Kratz PM, Jurewicz AJ, Cecconie T, Martens S, McDevitt PJ, Martin JD, Chen SB, Jiang Y, Nickels L, Schwartz BJ, Smallwood A, Zhao B, Campobasso N, Qian Y, Briand J, Rominger CM, Oleykowski C, Hardwicke MA, Luengo JI.. (2016) Discovery of a Novel 2,6-Disubstituted Glucosamine Series of Potent and Selective Hexokinase 2 Inhibitors., 7 (3): [PMID:26985301 ] [10.1021/acsmedchemlett.5b00214 ]