The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(4-(4-methoxy-3-methylbenzoyl)piperidin-1-yl)-4-oxobutyl)-7-methylthieno[3,4-d]pyrimidin-4(3H)-one ID: ALA3804939
PubChem CID: 136175128
Max Phase: Preclinical
Molecular Formula: C25H29N3O4S
Molecular Weight: 467.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(=O)C2CCN(C(=O)CCCc3nc4c(C)scc4c(=O)[nH]3)CC2)cc1C
Standard InChI: InChI=1S/C25H29N3O4S/c1-15-13-18(7-8-20(15)32-3)24(30)17-9-11-28(12-10-17)22(29)6-4-5-21-26-23-16(2)33-14-19(23)25(31)27-21/h7-8,13-14,17H,4-6,9-12H2,1-3H3,(H,26,27,31)
Standard InChI Key: PPFZSMPPXPFDAK-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-1.0028 1.5132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9991 -2.7132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6217 1.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9153 0.7255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2216 1.4644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5151 0.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8215 1.4422 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.5049 -0.4967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.1155 0.6834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.4196 1.4246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.4298 2.9245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1359 3.6833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8318 2.9422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.7331 3.6688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.7693 3.0635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-12.7412 5.1696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.0427 5.9153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.0477 7.4153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.7512 8.1696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.4497 7.4240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.4446 5.9240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.7532 9.6705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-11.7151 10.2725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0825 2.3453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.0890 8.0118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6 4 1 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 5 2 0
4 10 2 0
2 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
15 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
19 22 1 0
22 23 2 0
22 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
30 31 1 0
27 30 1 0
9 32 1 0
26 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 467.59Molecular Weight (Monoisotopic): 467.1879AlogP: 4.05#Rotatable Bonds: 7Polar Surface Area: 92.36Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.70CX Basic pKa: 3.97CX LogP: 3.29CX LogD: 3.29Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.53Np Likeness Score: -1.31