(Z)-6-(2-methoxyphenyl)-2-methyl-N'-(1-methyl-2-oxoindolin-3-ylidene)nicotinohydrazide

ID: ALA3805045

PubChem CID: 137225014

Max Phase: Preclinical

Molecular Formula: C23H20N4O3

Molecular Weight: 400.44

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccccc1-c1ccc(C(=O)N/N=C2\C(=O)N(C)c3ccccc32)c(C)n1

Standard InChI:  InChI=1S/C23H20N4O3/c1-14-15(12-13-18(24-14)16-8-5-7-11-20(16)30-3)22(28)26-25-21-17-9-4-6-10-19(17)27(2)23(21)29/h4-13H,1-3H3,(H,26,28)/b25-21-

Standard InChI Key:  OBDPVVQROQZQBB-DAFNUICNSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    4.1182    4.3614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5870    4.6698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5858    3.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0544    3.8559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5244    5.2803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5257    6.3996    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0571    6.0943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3178    5.2555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6500    2.9355    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1812    2.6271    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9937    5.5857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4615    7.0110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9301    6.2009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9942    4.4681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9296    7.3186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4624    4.7757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7889    0.0269    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0907   -2.3426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2582    6.9897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5293    3.0411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3309    2.1482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  2  7  2  0
  9 10  1  0
  1  8  2  0
  1  9  1  0
 11 12  1  0
 11 14  2  0
 12 15  2  0
 13 15  1  0
 13 16  2  0
 14 16  1  0
  5 11  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 17 25  1  0
 20 25  2  0
 18 26  2  0
 17 27  1  0
 10 19  2  0
  7 28  1  0
 14 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3805045

    ---

Associated Targets(Human)

CASP3 Tchem Caspase-3 (3632 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CASP7 Tchem Caspase-7 (3146 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 400.44Molecular Weight (Monoisotopic): 400.1535AlogP: 3.18#Rotatable Bonds: 4
Polar Surface Area: 83.89Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.95CX Basic pKa: 3.18CX LogP: 2.88CX LogD: 2.88
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.68Np Likeness Score: -1.32

References

1. Deng CB, Li J, Li LY, Sun FJ..  (2016)  Protective effect of novel substituted nicotine hydrazide analogues against hypoxic brain injury in neonatal rats via inhibition of caspase.,  26  (13): [PMID:27216999] [10.1016/j.bmcl.2016.04.031]

Source