The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((3R,4R,5S,6R)-6-((2-chlorophenylsulfonamido)methyl)-2,4,5-trihydroxytetrahydro-2H-pyran-3-yl)biphenyl-3-carboxamide ID: ALA3805148
PubChem CID: 127052626
Max Phase: Preclinical
Molecular Formula: C25H25ClN2O7S
Molecular Weight: 533.00
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(N[C@H]1C(O)O[C@H](CNS(=O)(=O)c2ccccc2Cl)[C@@H](O)[C@@H]1O)c1cccc(-c2ccccc2)c1
Standard InChI: InChI=1S/C25H25ClN2O7S/c26-18-11-4-5-12-20(18)36(33,34)27-14-19-22(29)23(30)21(25(32)35-19)28-24(31)17-10-6-9-16(13-17)15-7-2-1-3-8-15/h1-13,19,21-23,25,27,29-30,32H,14H2,(H,28,31)/t19-,21-,22-,23-,25?/m1/s1
Standard InChI Key: IHJLHPKDAHRLLB-XVBLYABRSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
5.2024 -2.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.1622 -2.0952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5973 1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5549 3.6021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8933 3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8934 5.2570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1924 6.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4915 5.2571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4915 3.7571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1925 3.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7912 3.0067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0915 3.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3894 3.0026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3870 1.5026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0868 0.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7890 1.5067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 -1.3500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4990 -0.7409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7991 -1.4891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0971 -0.7372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0949 0.7628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7948 1.5109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4969 0.7591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8008 -2.6891 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 2 1 0
4 5 1 0
6 5 1 6
6 7 1 0
7 8 1 0
8 9 1 0
8 10 1 0
10 11 1 1
11 12 1 0
12 13 2 0
12 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
10 26 1 0
26 27 1 6
26 28 1 0
28 29 1 1
28 6 1 0
2 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
31 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 533.00Molecular Weight (Monoisotopic): 532.1071AlogP: 1.52#Rotatable Bonds: 7Polar Surface Area: 145.19Molecular Species: NEUTRALHBA: 7HBD: 5#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.08CX Basic pKa: ┄CX LogP: 2.21CX LogD: 2.20Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.31Np Likeness Score: -0.44
References 1. Lin H, Zeng J, Xie R, Schulz MJ, Tedesco R, Qu J, Erhard KF, Mack JF, Raha K, Rendina AR, Szewczuk LM, Kratz PM, Jurewicz AJ, Cecconie T, Martens S, McDevitt PJ, Martin JD, Chen SB, Jiang Y, Nickels L, Schwartz BJ, Smallwood A, Zhao B, Campobasso N, Qian Y, Briand J, Rominger CM, Oleykowski C, Hardwicke MA, Luengo JI.. (2016) Discovery of a Novel 2,6-Disubstituted Glucosamine Series of Potent and Selective Hexokinase 2 Inhibitors., 7 (3): [PMID:26985301 ] [10.1021/acsmedchemlett.5b00214 ]