The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(5-chloro-6-(2H-1,2,3-triazol-2-yl)pyridin-3-yl)-3-(2-chloro-7-(1-cyclopropyl-2-methoxyethyl)pyrazolo[1,5-a]pyrimidin-6-yl)urea ID: ALA3805390
PubChem CID: 127050487
Max Phase: Preclinical
Molecular Formula: C20H19Cl2N9O2
Molecular Weight: 488.34
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCC(c1c(NC(=O)Nc2cnc(-n3nccn3)c(Cl)c2)cnc2cc(Cl)nn12)C1CC1
Standard InChI: InChI=1S/C20H19Cl2N9O2/c1-33-10-13(11-2-3-11)18-15(9-23-17-7-16(22)29-30(17)18)28-20(32)27-12-6-14(21)19(24-8-12)31-25-4-5-26-31/h4-9,11,13H,2-3,10H2,1H3,(H2,27,28,32)
Standard InChI Key: ZBPMJTCUOXGGGP-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
-1.0028 1.5132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6217 -1.4865 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9153 -0.7255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2216 -1.4644 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9050 0.4745 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.5151 -0.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8219 -1.4399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1132 -0.6766 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-10.0978 0.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.7911 1.5600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4999 0.7967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9984 -3.0138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7889 0.0269 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.3032 -3.7611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2946 -3.7703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2884 -5.2712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3248 -5.8761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7240 -3.7114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9777 -5.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.7788 2.7599 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-11.3897 1.5870 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-12.7484 0.9820 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-13.7388 2.1085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9735 3.3986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.5101 3.0694 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6 4 1 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 2 0
3 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
4 20 1 0
8 21 1 0
20 22 1 0
20 23 1 0
23 24 1 0
24 25 1 0
26 22 1 0
27 26 1 0
22 27 1 0
18 28 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 29 1 0
17 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 488.34Molecular Weight (Monoisotopic): 487.1039AlogP: 3.80#Rotatable Bonds: 7Polar Surface Area: 124.15Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.89CX Basic pKa: ┄CX LogP: 2.58CX LogD: 2.58Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.41Np Likeness Score: -1.67