(Z)-6-(2-bromophenyl)-2-methyl-N'-(1-methyl-2-oxoindolin-3-ylidene)nicotinohydrazide

ID: ALA3805458

PubChem CID: 137225055

Max Phase: Preclinical

Molecular Formula: C22H17BrN4O2

Molecular Weight: 449.31

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1nc(-c2ccccc2Br)ccc1C(=O)N/N=C1\C(=O)N(C)c2ccccc21

Standard InChI:  InChI=1S/C22H17BrN4O2/c1-13-14(11-12-18(24-13)15-7-3-5-9-17(15)23)21(28)26-25-20-16-8-4-6-10-19(16)27(2)22(20)29/h3-12H,1-2H3,(H,26,28)/b25-20-

Standard InChI Key:  AYNSQOREFZGEKI-QQTULTPQSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    4.1182    4.3614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5870    4.6698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5858    3.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0544    3.8559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5244    5.2803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5257    6.3996    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0571    6.0943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3178    5.2555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6500    2.9355    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1812    2.6271    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9937    5.5857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4615    7.0110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9296    7.3186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9301    6.2009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4624    4.7757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9942    4.4681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7889    0.0269    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0907   -2.3426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2582    6.9897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6201    3.3279    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  2  7  2  0
  9 10  1  0
  1  8  2  0
  1  9  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 11 16  2  0
  5 11  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 17 25  1  0
 20 25  2  0
 18 26  2  0
 17 27  1  0
 10 19  2  0
  7 28  1  0
 16 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3805458

    ---

Associated Targets(Human)

CASP3 Tchem Caspase-3 (3632 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CASP7 Tchem Caspase-7 (3146 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 449.31Molecular Weight (Monoisotopic): 448.0535AlogP: 3.93#Rotatable Bonds: 3
Polar Surface Area: 74.66Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.97CX Basic pKa: 3.34CX LogP: 3.81CX LogD: 3.81
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.62Np Likeness Score: -1.42

References

1. Deng CB, Li J, Li LY, Sun FJ..  (2016)  Protective effect of novel substituted nicotine hydrazide analogues against hypoxic brain injury in neonatal rats via inhibition of caspase.,  26  (13): [PMID:27216999] [10.1016/j.bmcl.2016.04.031]

Source