The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(1-(4-(7-methyl-4-oxo-3,4-dihydropyrrolo[1,2-f][1,2,4]triazin-2-yl)butanoyl)piperidin-4-yloxy)benzonitrile ID: ALA3805627
PubChem CID: 136175127
Max Phase: Preclinical
Molecular Formula: C23H25N5O3
Molecular Weight: 419.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc2c(=O)[nH]c(CCCC(=O)N3CCC(Oc4ccc(C#N)cc4)CC3)nn12
Standard InChI: InChI=1S/C23H25N5O3/c1-16-5-10-20-23(30)25-21(26-28(16)20)3-2-4-22(29)27-13-11-19(12-14-27)31-18-8-6-17(15-24)7-9-18/h5-10,19H,2-4,11-14H2,1H3,(H,25,26,30)
Standard InChI Key: CEKWANGMSIIGAG-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
-1.0028 1.5132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9991 -2.7132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6217 1.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9153 0.7255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2216 1.4644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5151 0.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8215 1.4422 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.5049 -0.4967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.1155 0.6834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.4196 1.4246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.4298 2.9245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1359 3.6833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8318 2.9422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.7331 3.6688 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-12.7412 5.1696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0825 2.3453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.0427 5.9153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.0477 7.4153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.7512 8.1696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.4497 7.4240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.4446 5.9240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.7562 9.6704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.7603 10.8704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6 4 1 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 5 1 0
4 10 2 0
2 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
15 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
19 22 1 0
22 23 1 0
9 24 1 0
23 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 23 1 0
30 31 3 0
27 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 419.49Molecular Weight (Monoisotopic): 419.1957AlogP: 2.60#Rotatable Bonds: 6Polar Surface Area: 103.49Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.40CX Basic pKa: 2.52CX LogP: 1.21CX LogD: 1.21Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.66Np Likeness Score: -1.37