The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-2-methyl-N'-(1-methyl-2-oxoindolin-3-ylidene)-6-(3,4,5-trimethoxyphenyl)nicotinohydrazide ID: ALA3805679
PubChem CID: 137225026
Max Phase: Preclinical
Molecular Formula: C25H24N4O5
Molecular Weight: 460.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(-c2ccc(C(=O)N/N=C3\C(=O)N(C)c4ccccc43)c(C)n2)cc(OC)c1OC
Standard InChI: InChI=1S/C25H24N4O5/c1-14-16(24(30)28-27-22-17-8-6-7-9-19(17)29(2)25(22)31)10-11-18(26-14)15-12-20(32-3)23(34-5)21(13-15)33-4/h6-13H,1-5H3,(H,28,30)/b27-22-
Standard InChI Key: ARBAZNGYYOYPKG-QYQHSDTDSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
4.1182 4.3614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5870 4.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5858 3.5506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0544 3.8559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5244 5.2803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5257 6.3996 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0571 6.0943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3178 5.2555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6500 2.9355 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1812 2.6271 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9937 5.5857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9943 4.4681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9301 6.2009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4615 7.0110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4624 4.7757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9296 7.3186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7889 0.0269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0907 -2.3426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2582 6.9897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3947 8.7455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5930 9.6385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3984 6.5117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7709 7.6524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4611 3.6554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0853 2.5157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
2 7 2 0
9 10 1 0
1 8 2 0
1 9 1 0
11 12 1 0
11 14 2 0
12 15 2 0
13 15 1 0
13 16 2 0
14 16 1 0
5 11 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
17 25 1 0
20 25 2 0
18 26 2 0
17 27 1 0
10 19 2 0
7 28 1 0
16 29 1 0
29 30 1 0
13 31 1 0
31 32 1 0
15 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.49Molecular Weight (Monoisotopic): 460.1747AlogP: 3.19#Rotatable Bonds: 6Polar Surface Area: 102.35Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.01CX Basic pKa: 3.85CX LogP: 2.57CX LogD: 2.57Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.57Np Likeness Score: -1.06
References 1. Deng CB, Li J, Li LY, Sun FJ.. (2016) Protective effect of novel substituted nicotine hydrazide analogues against hypoxic brain injury in neonatal rats via inhibition of caspase., 26 (13): [PMID:27216999 ] [10.1016/j.bmcl.2016.04.031 ]