The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-(4-(aminomethyl)-1H-pyrazol-1-yl)-3-chlorophenyl)-3-(2-chloro-7-isopropylpyrazolo[1,5-a]pyrimidin-6-yl)urea ID: ALA3806299
PubChem CID: 118540075
Max Phase: Preclinical
Molecular Formula: C20H20Cl2N8O
Molecular Weight: 459.34
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)c1c(NC(=O)Nc2ccc(-n3cc(CN)cn3)c(Cl)c2)cnc2cc(Cl)nn12
Standard InChI: InChI=1S/C20H20Cl2N8O/c1-11(2)19-15(9-24-18-6-17(22)28-30(18)19)27-20(31)26-13-3-4-16(14(21)5-13)29-10-12(7-23)8-25-29/h3-6,8-11H,7,23H2,1-2H3,(H2,26,27,31)
Standard InChI Key: OZELESYVBXOCIX-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
-1.0028 1.5132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6217 -1.4865 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9153 -0.7255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2216 -1.4644 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9050 0.4745 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.5151 -0.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8219 -1.4399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1132 -0.6766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.0978 0.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.7911 1.5600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4999 0.7967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9971 -3.0138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7889 0.0269 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-8.7788 2.7599 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-11.3897 1.5870 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-12.7484 0.9820 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-13.7388 2.1085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9735 3.3986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.5101 3.0694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0337 -3.6184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0446 -3.6095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.5638 4.7756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.8456 5.7370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6 4 1 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 2 0
3 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
4 20 1 0
8 21 1 0
18 22 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 23 1 0
17 23 1 0
20 28 1 0
20 29 1 0
26 30 1 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.34Molecular Weight (Monoisotopic): 458.1137AlogP: 4.45#Rotatable Bonds: 5Polar Surface Area: 115.16Molecular Species: BASEHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.98CX Basic pKa: 8.79CX LogP: 3.53CX LogD: 2.13Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.41Np Likeness Score: -2.15