1-(4-(4-(aminomethyl)-1H-pyrazol-1-yl)-3-chlorophenyl)-3-(2-chloro-7-isopropylpyrazolo[1,5-a]pyrimidin-6-yl)urea

ID: ALA3806299

PubChem CID: 118540075

Max Phase: Preclinical

Molecular Formula: C20H20Cl2N8O

Molecular Weight: 459.34

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)c1c(NC(=O)Nc2ccc(-n3cc(CN)cn3)c(Cl)c2)cnc2cc(Cl)nn12

Standard InChI:  InChI=1S/C20H20Cl2N8O/c1-11(2)19-15(9-24-18-6-17(22)28-30(18)19)27-20(31)26-13-3-4-16(14(21)5-13)29-10-12(7-23)8-25-29/h3-6,8-11H,7,23H2,1-2H3,(H2,26,27,31)

Standard InChI Key:  OZELESYVBXOCIX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   -1.0028    1.5132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6217   -1.4865    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9153   -0.7255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2216   -1.4644    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9050    0.4745    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5151   -0.7033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8219   -1.4399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1132   -0.6766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.0978    0.8233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7911    1.5600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4999    0.7967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9971   -3.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7889    0.0269    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -8.7788    2.7599    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  -11.3897    1.5870    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -12.7484    0.9820    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -13.7388    2.1085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9735    3.3986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.5101    3.0694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0337   -3.6184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0446   -3.6095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.5638    4.7756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.8456    5.7370    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  6  4  1  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
  3 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
 12 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
  4 20  1  0
  8 21  1  0
 18 22  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 23  1  0
 17 23  1  0
 20 28  1  0
 20 29  1  0
 26 30  1  0
 30 31  1  0
M  END

Associated Targets(Human)

BIRC3 Tchem Baculoviral IAP repeat-containing protein 3/Mucosa-associated lymphoid tissue lymphoma translocation protein 1 (7 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MALT1 Tchem Mucosa-associated lymphoid tissue lymphoma translocation protein 1 (705 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 459.34Molecular Weight (Monoisotopic): 458.1137AlogP: 4.45#Rotatable Bonds: 5
Polar Surface Area: 115.16Molecular Species: BASEHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 10.98CX Basic pKa: 8.79CX LogP: 3.53CX LogD: 2.13
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.41Np Likeness Score: -2.15

References

1. Abdel-Magid AF..  (2016)  MALT1 Inhibitors May Potentially Treat Lymphomas and Autoimmune Disorders.,  (3): [PMID:26985302] [10.1021/acsmedchemlett.6b00015]

Source