The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-(2-(1-hydroxy-3-methyl-1-(3-(trifluoromethyl)phenyl)butyl)-1H-imidazol-4-yl)-2-oxo-1,2-dihydropyridin-4-yl)thiazole-4-carboxamide ID: ALA3808401
PubChem CID: 127043428
Max Phase: Preclinical
Molecular Formula: C24H22F3N5O3S
Molecular Weight: 517.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)CC(O)(c1cccc(C(F)(F)F)c1)c1nc(-n2ccc(NC(=O)c3cscn3)cc2=O)c[nH]1
Standard InChI: InChI=1S/C24H22F3N5O3S/c1-14(2)10-23(35,15-4-3-5-16(8-15)24(25,26)27)22-28-11-19(31-22)32-7-6-17(9-20(32)33)30-21(34)18-12-36-13-29-18/h3-9,11-14,35H,10H2,1-2H3,(H,28,31)(H,30,34)
Standard InChI Key: VEYOCGAKDPCFHN-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
3.9263 -5.8797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8082 -4.6653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6149 -4.5391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2003 1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8969 -0.4545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3383 1.3500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.5517 0.8722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5554 1.9869 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-6.8054 3.2859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3382 2.9741 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9511 -0.8815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9531 -1.9978 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2010 -3.2956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7343 -2.9815 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3006 -4.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9078 -6.1970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3992 -6.3569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2835 -5.1453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6762 -3.7737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1848 -3.6137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0068 -7.7293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3000 -8.6991 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.2000 -7.8569 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.4931 -8.8263 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.5361 -7.2510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8310 -8.2220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7295 -7.3766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
7 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
5 14 2 0
12 15 2 0
15 16 1 0
16 17 1 0
17 18 2 0
18 12 1 0
4 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 2 0
23 19 1 0
22 2 1 0
2 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
26 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
1 34 1 0
34 35 1 0
34 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 517.53Molecular Weight (Monoisotopic): 517.1395AlogP: 4.57#Rotatable Bonds: 7Polar Surface Area: 112.90Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.93CX Basic pKa: 0.13CX LogP: 3.72CX LogD: 3.72Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.33Np Likeness Score: -1.36
References 1. Fader L, Brault M, Desjardins J, Dansereau N, Lamorte L, Tremblay S, Bilodeau F, Bordeleau J, Duplessis M, Gorys V, Gillard J, Gleason JL, James C, Joly MA, Kuhn C, Llinas-Brunet M, Luo L, Morency L, Morin S, Parisien M, Poirier M, Thibeault C, Trinh T, Sturino C, Srivastava S, Yoakim C, Franti M.. (2016) Discovery of Potent, Orally Bioavailable Inhibitors of Human Cytomegalovirus., 7 (5): [PMID:27190604 ] [10.1021/acsmedchemlett.6b00064 ]