The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-acetyl-1H-indol-3-yl)-N-(5-methoxy-2-methylphenyl)-3-(trifluoromethyl)benzamide ID: ALA3808440
PubChem CID: 127045564
Max Phase: Preclinical
Molecular Formula: C26H21F3N2O3
Molecular Weight: 466.46
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C)c(N(C(=O)c2cccc(C(F)(F)F)c2)c2cn(C(C)=O)c3ccccc23)c1
Standard InChI: InChI=1S/C26H21F3N2O3/c1-16-11-12-20(34-3)14-23(16)31(25(33)18-7-6-8-19(13-18)26(27,28)29)24-15-30(17(2)32)22-10-5-4-9-21(22)24/h4-15H,1-3H3
Standard InChI Key: BYQBYBUGRMJLNZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
3.6490 2.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6510 1.8181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1195 2.1239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1186 1.0050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6493 -0.4196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1808 -0.7255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1816 0.3933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0226 4.0759 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1802 2.6274 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5879 1.3111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1782 3.7448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2903 3.4390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2894 4.5579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8201 5.9825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6484 6.2884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6475 5.1696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6659 2.2993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1210 7.7129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2961 7.9559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1855 -2.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3606 -2.8684 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3877 -3.5218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9641 2.4506 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.3869 0.4157 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.7628 1.5552 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
2 7 2 0
1 8 2 0
1 9 1 0
4 10 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
11 16 2 0
12 17 1 0
18 19 1 0
15 18 1 0
9 11 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
20 28 1 0
23 28 2 0
29 30 2 0
29 31 1 0
20 29 1 0
9 22 1 0
10 32 1 0
10 33 1 0
10 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.46Molecular Weight (Monoisotopic): 466.1504AlogP: 6.62#Rotatable Bonds: 4Polar Surface Area: 51.54Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.24CX LogD: 5.24Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.34Np Likeness Score: -1.12
References 1. Unzue A, Zhao H, Lolli G, Dong J, Zhu J, Zechner M, Dolbois A, Caflisch A, Nevado C.. (2016) The "Gatekeeper" Residue Influences the Mode of Binding of Acetyl Indoles to Bromodomains., 59 (7): [PMID:26982797 ] [10.1021/acs.jmedchem.5b01757 ]