The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[4-(1H-Benzimidazol-2-yl)-phenyl]-N'-benzyl-2-morpholin-4-yl-[1,3,5]triazine-4,6-diamine ID: ALA3808601
PubChem CID: 127044104
Max Phase: Preclinical
Molecular Formula: C27H26N8O
Molecular Weight: 478.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: c1ccc(CNc2nc(Nc3ccc(-c4nc5ccccc5[nH]4)cc3)nc(N3CCOCC3)n2)cc1
Standard InChI: InChI=1S/C27H26N8O/c1-2-6-19(7-3-1)18-28-25-32-26(34-27(33-25)35-14-16-36-17-15-35)29-21-12-10-20(11-13-21)24-30-22-8-4-5-9-23(22)31-24/h1-13H,14-18H2,(H,30,31)(H2,28,29,32,33,34)
Standard InChI Key: ARDDAVHJFTWADI-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
10.4848 4.4773 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3427 3.2468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7060 1.8887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2114 1.7609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3536 2.9915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9903 4.3496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5716 0.4033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1345 5.5826 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8380 3.3746 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4770 4.7317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9717 4.8570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8276 3.6252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1888 2.2681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6940 2.1427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7735 6.9406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9177 8.1735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5543 9.5317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6965 10.7622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2020 10.6345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5652 9.2764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4231 8.0459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0761 0.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4347 -1.0784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9397 -1.2009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0896 0.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7275 1.3885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2225 1.5111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 2 0
4 7 1 0
6 8 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
9 14 1 0
2 9 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
16 21 2 0
8 15 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
22 27 2 0
28 29 2 0
29 30 1 0
30 31 1 0
31 32 1 0
28 32 1 0
33 34 1 0
34 35 2 0
35 36 1 0
31 36 2 0
30 33 2 0
25 28 1 0
7 22 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 478.56Molecular Weight (Monoisotopic): 478.2230AlogP: 4.61#Rotatable Bonds: 7Polar Surface Area: 103.88Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.56CX Basic pKa: 7.51CX LogP: 5.73CX LogD: 5.38Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.31Np Likeness Score: -1.52
References 1. Singla P, Luxami V, Paul K.. (2016) Synthesis and in vitro evaluation of novel triazine analogues as anticancer agents and their interaction studies with bovine serum albumin., 117 [PMID:27089212 ] [10.1016/j.ejmech.2016.03.088 ]