Your company account is blocked and you cannot place orders. If you have questions, please contact your company administrator.

N2,N4-bis(4-fluorophenyl)-N6-(2-morpholinoethyl)-1,3,5-triazine-2,4,6-triamine

ID: ALA380861

PubChem CID: 44408452

Max Phase: Preclinical

Molecular Formula: C21H23F2N7O

Molecular Weight: 427.46

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Fc1ccc(Nc2nc(NCCN3CCOCC3)nc(Nc3ccc(F)cc3)n2)cc1

Standard InChI:  InChI=1S/C21H23F2N7O/c22-15-1-5-17(6-2-15)25-20-27-19(24-9-10-30-11-13-31-14-12-30)28-21(29-20)26-18-7-3-16(23)4-8-18/h1-8H,9-14H2,(H3,24,25,26,27,28,29)

Standard InChI Key:  XARHVILHYGKXGM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   11.3621  -11.6926    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3609  -12.5201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0757  -12.9330    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7923  -12.5196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7894  -11.6890    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0739  -11.2799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6460  -12.9320    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9319  -12.5190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9371  -11.6940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2237  -11.2810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5078  -11.6930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5098  -12.5224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2238  -12.9316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5075  -12.9310    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0715  -10.4548    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3558  -10.0444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3567   -9.2200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6417   -8.8098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9275   -9.2244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9326  -10.0538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6480  -10.4604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2213  -12.5174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9365  -12.9288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6503  -12.5151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0816  -11.6872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.3650  -11.2764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6548  -11.6892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3716  -12.9255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0880  -12.5110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2111   -8.8150    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.7931  -11.2809    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  6 15  1  0
  3  4  1  0
 15 16  1  0
  7  8  1  0
 16 17  2  0
 17 18  1  0
  8  9  2  0
 18 19  2  0
  4  5  2  0
 19 20  1  0
  9 10  1  0
 20 21  2  0
 21 16  1  0
  2  3  2  0
 14 22  1  0
 10 11  2  0
 22 23  1  0
  5  6  1  0
 23 24  1  0
 11 12  1  0
  6  1  2  0
 12 13  2  0
 13  8  1  0
  1  2  1  0
 25 29  1  0
 25 26  1  0
 26 27  1  0
 27 24  1  0
 24 28  1  0
 28 29  1  0
  4 14  1  0
 19 30  1  0
  2  7  1  0
 11 31  1  0
M  END

Associated Targets(non-human)

dnaB Replicative DNA helicase (15 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Escherichia coli (133304 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Pseudomonas aeruginosa (123386 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Staphylococcus aureus (210822 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Calculated Properties

Molecular Weight: 427.46Molecular Weight (Monoisotopic): 427.1932AlogP: 3.38#Rotatable Bonds: 8
Polar Surface Area: 87.23Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.76CX Basic pKa: 6.16CX LogP: 4.33CX LogD: 4.31
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.50Np Likeness Score: -1.51

References

1. McKay GA, Reddy R, Arhin F, Belley A, Lehoux D, Moeck G, Sarmiento I, Parr TR, Gros P, Pelletier J, Far AR..  (2006)  Triaminotriazine DNA helicase inhibitors with antibacterial activity.,  16  (5): [PMID:16343901] [10.1016/j.bmcl.2005.11.076]

Source