3-((E)-3-((3-((E)-2-(7-chloroquinolin-2-yl)vinyl)phenyl)amino)-3-oxoprop-1-en-1-yl)-5-methoxy-1H-indole-2-carboxylic acid

ID: ALA3808613

PubChem CID: 127043248

Max Phase: Preclinical

Molecular Formula: C30H22ClN3O4

Molecular Weight: 523.98

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2[nH]c(C(=O)O)c(/C=C/C(=O)Nc3cccc(/C=C/c4ccc5ccc(Cl)cc5n4)c3)c2c1

Standard InChI:  InChI=1S/C30H22ClN3O4/c1-38-23-11-13-26-25(17-23)24(29(34-26)30(36)37)12-14-28(35)33-22-4-2-3-18(15-22)5-9-21-10-7-19-6-8-20(31)16-27(19)32-21/h2-17,34H,1H3,(H,33,35)(H,36,37)/b9-5+,14-12+

Standard InChI Key:  NJVMCVNHNUOPCA-BNCZNCEZSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
  -17.2053   -1.0248    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -15.7375   -0.7030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.6116    0.7547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -16.9562    1.3764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -17.4055    2.8118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -18.8933    3.1214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -19.8939    2.0107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -19.4311    0.5631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -17.9569    0.2657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.6084   -1.6878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.8384   -2.8656    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -13.4733   -1.2985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -14.3102    1.5023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.0116    0.7499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.7103    1.4975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.7081    2.6975    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -10.4117    0.7451    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1103    1.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8113    0.7426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5121    1.4924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5121    2.9924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8110    3.7426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1101    2.9927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2109    0.7445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9122    1.4966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964    1.4973    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6321    1.3486    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  -19.3692    4.5448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -20.5449    4.7849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  1  9  1  0
  4  9  2  0
 10 11  2  0
 10 12  1  0
  2 10  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 18 23  2  0
 24 25  2  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 26 35  1  0
 30 35  1  0
 33 36  1  0
 25 27  1  0
 20 24  1  0
 17 18  1  0
 15 17  1  0
  3 13  1  0
  6 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3808613

    ---

Associated Targets(Human)

CYSLTR1 Tclin Cysteinyl leukotriene receptor 1 (2118 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CYSLTR2 Tchem Cysteinyl leukotriene receptor 2 (135 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 523.98Molecular Weight (Monoisotopic): 523.1299AlogP: 6.90#Rotatable Bonds: 7
Polar Surface Area: 104.31Molecular Species: ACIDHBA: 4HBD: 3
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.72CX Basic pKa: 3.01CX LogP: 5.96CX LogD: 3.08
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.20Np Likeness Score: -0.83

References

1. Chen H, Yang H, Wang Z, Xie X, Nan F..  (2016)  Discovery of 3-Substituted 1H-Indole-2-carboxylic Acid Derivatives as a Novel Class of CysLT1 Selective Antagonists.,  (3): [PMID:26985325] [10.1021/acsmedchemlett.5b00482]

Source