The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,6-dichloro-3-((E)-3-((3-((E)-2-(7-chloroquinolin-2-yl)vinyl)benzyl)oxy)-3-oxoprop-1-en-1-yl)-1H-indole-2-carboxylic acid ID: ALA3808623
PubChem CID: 127043252
Max Phase: Preclinical
Molecular Formula: C30H19Cl3N2O4
Molecular Weight: 577.85
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(/C=C/c1c(C(=O)O)[nH]c2cc(Cl)cc(Cl)c12)OCc1cccc(/C=C/c2ccc3ccc(Cl)cc3n2)c1
Standard InChI: InChI=1S/C30H19Cl3N2O4/c31-20-7-5-19-6-9-22(34-25(19)14-20)8-4-17-2-1-3-18(12-17)16-39-27(36)11-10-23-28-24(33)13-21(32)15-26(28)35-29(23)30(37)38/h1-15,35H,16H2,(H,37,38)/b8-4+,11-10+
Standard InChI Key: UCASXYXKIOSALC-IBYINHFXSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
-10.0194 16.7817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.4827 17.0879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.5011 15.9598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.5387 15.3400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.5533 14.2298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.0166 14.5360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.7540 13.2374 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-11.7376 12.1306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.4143 12.7550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.0208 10.6593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.1134 9.8741 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-13.1544 10.2657 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.1136 12.0062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1108 10.5054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8101 9.7566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8072 8.2558 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.7718 10.3583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.5065 7.5071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5036 6.0062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2047 5.2560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2049 3.7560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5041 3.0062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8030 3.7564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8028 5.2564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9067 3.0027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9091 1.5019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.3649 15.0907 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-11.8546 18.2288 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.6321 1.3486 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
8 10 1 0
10 11 1 0
10 12 2 0
9 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
21 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 32 2 0
31 30 2 0
30 27 1 0
31 32 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
4 37 1 0
2 38 1 0
35 39 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 577.85Molecular Weight (Monoisotopic): 576.0410AlogP: 8.30#Rotatable Bonds: 7Polar Surface Area: 92.28Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.72CX Basic pKa: 3.01CX LogP: 7.99CX LogD: 5.11Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.15Np Likeness Score: -0.50
References 1. Chen H, Yang H, Wang Z, Xie X, Nan F.. (2016) Discovery of 3-Substituted 1H-Indole-2-carboxylic Acid Derivatives as a Novel Class of CysLT1 Selective Antagonists., 7 (3): [PMID:26985325 ] [10.1021/acsmedchemlett.5b00482 ]