5-(2-((2-(2-(Benzyloxy)phenoxy)ethyl)amino)propyl)-1-(3-hydroxypropyl)indoline-7-carboxamide

ID: ALA3808632

PubChem CID: 127045050

Max Phase: Preclinical

Molecular Formula: C30H37N3O4

Molecular Weight: 503.64

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(Cc1cc2c(c(C(N)=O)c1)N(CCCO)CC2)NCCOc1ccccc1OCc1ccccc1

Standard InChI:  InChI=1S/C30H37N3O4/c1-22(18-24-19-25-12-15-33(14-7-16-34)29(25)26(20-24)30(31)35)32-13-17-36-27-10-5-6-11-28(27)37-21-23-8-3-2-4-9-23/h2-6,8-11,19-20,22,32,34H,7,12-18,21H2,1H3,(H2,31,35)

Standard InChI Key:  REJMTGCSIUAMRO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6187    1.4919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6267    2.9927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9300    3.7369    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5905    3.5979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9380    5.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2413    5.9820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2494    7.4828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5527    8.2271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8467    7.4683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1508    8.2095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1609    9.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8670   10.4683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5629    9.7271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1855   -2.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6552   -2.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1277   -4.3539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3028   -4.5970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9971   -3.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0337   -3.6184    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0446   -3.6095    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2698   10.4890    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2822   11.9897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9891   12.7516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6849   12.0105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3910   12.7694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4012   14.2693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7054   15.0105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9993   14.2516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  1 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  1  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  7 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
  3 27  1  0
 27 28  2  0
 27 29  1  0
 22 30  1  0
 30 31  1  0
 31 32  1  0
 32 37  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3808632

    ---

Associated Targets(Human)

ADRA1D Tclin Alpha-1d adrenergic receptor (4171 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADRA1A Tclin Alpha-1a adrenergic receptor (8359 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADRA1B Tclin Alpha-1b adrenergic receptor (2912 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 503.64Molecular Weight (Monoisotopic): 503.2784AlogP: 3.71#Rotatable Bonds: 14
Polar Surface Area: 97.05Molecular Species: BASEHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.66CX LogP: 3.82CX LogD: 1.60
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.29Np Likeness Score: -0.53

References

1. Zhao F, Li J, Chen Y, Tian Y, Wu C, Xie Y, Zhou Y, Wang J, Xie X, Liu H..  (2016)  Design, Synthesis, and Biological Evaluation of Indoline and Indole Derivatives as Potent and Selective α1A-Adrenoceptor Antagonists.,  59  (8): [PMID:27031406] [10.1021/acs.jmedchem.5b02023]

Source