The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(2-((2-(2-(Benzyloxy)phenoxy)ethyl)amino)propyl)-1-(3-hydroxypropyl)indoline-7-carboxamide ID: ALA3808632
PubChem CID: 127045050
Max Phase: Preclinical
Molecular Formula: C30H37N3O4
Molecular Weight: 503.64
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(Cc1cc2c(c(C(N)=O)c1)N(CCCO)CC2)NCCOc1ccccc1OCc1ccccc1
Standard InChI: InChI=1S/C30H37N3O4/c1-22(18-24-19-25-12-15-33(14-7-16-34)29(25)26(20-24)30(31)35)32-13-17-36-27-10-5-6-11-28(27)37-21-23-8-3-2-4-9-23/h2-6,8-11,19-20,22,32,34H,7,12-18,21H2,1H3,(H2,31,35)
Standard InChI Key: REJMTGCSIUAMRO-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6187 1.4919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6267 2.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9300 3.7369 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5905 3.5979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9380 5.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2413 5.9820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2494 7.4828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.5527 8.2271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8467 7.4683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1508 8.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1609 9.7095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8670 10.4683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5629 9.7271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1855 -2.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6552 -2.9294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1277 -4.3539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3028 -4.5970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9971 -3.0138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0337 -3.6184 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0446 -3.6095 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.2698 10.4890 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.2822 11.9897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9891 12.7516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6849 12.0105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3910 12.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4012 14.2693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7054 15.0105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9993 14.2516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
1 10 1 0
10 11 1 0
11 12 1 0
11 13 1 0
12 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
7 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
3 27 1 0
27 28 2 0
27 29 1 0
22 30 1 0
30 31 1 0
31 32 1 0
32 37 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.64Molecular Weight (Monoisotopic): 503.2784AlogP: 3.71#Rotatable Bonds: 14Polar Surface Area: 97.05Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.66CX LogP: 3.82CX LogD: 1.60Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.29Np Likeness Score: -0.53
References 1. Zhao F, Li J, Chen Y, Tian Y, Wu C, Xie Y, Zhou Y, Wang J, Xie X, Liu H.. (2016) Design, Synthesis, and Biological Evaluation of Indoline and Indole Derivatives as Potent and Selective α1A-Adrenoceptor Antagonists., 59 (8): [PMID:27031406 ] [10.1021/acs.jmedchem.5b02023 ]