The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(2-((2-(5-Bromo-2-(2,2,2-trifluoroethoxy)phenoxy)ethyl)-amino)propyl)-1-(3-hydroxypropyl)indoline-7-carboxamide ID: ALA3808726
PubChem CID: 123667086
Max Phase: Preclinical
Molecular Formula: C25H31BrF3N3O4
Molecular Weight: 574.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(Cc1cc2c(c(C(N)=O)c1)N(CCCO)CC2)NCCOc1cc(Br)ccc1OCC(F)(F)F
Standard InChI: InChI=1S/C25H31BrF3N3O4/c1-16(31-6-10-35-22-14-19(26)3-4-21(22)36-15-25(27,28)29)11-17-12-18-5-8-32(7-2-9-33)23(18)20(13-17)24(30)34/h3-4,12-14,16,31,33H,2,5-11,15H2,1H3,(H2,30,34)
Standard InChI Key: RWDAFKHZHMRDPE-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6187 1.4919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6267 2.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9300 3.7369 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5905 3.5979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9380 5.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2413 5.9820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2494 7.4828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.5527 8.2271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8467 7.4683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1508 8.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1609 9.7095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8670 10.4683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5629 9.7271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1855 -2.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6552 -2.9294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1277 -4.3539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3028 -4.5970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9971 -3.0138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0337 -3.6184 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0446 -3.6095 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.2698 10.4890 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.2822 11.9897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9891 12.7516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9990 13.9516 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.9448 12.1605 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.9549 13.3603 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-11.1859 7.6025 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
1 10 1 0
10 11 1 0
11 12 1 0
11 13 1 0
12 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
7 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
3 27 1 0
27 28 2 0
27 29 1 0
22 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
32 34 1 0
32 35 1 0
19 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 574.44Molecular Weight (Monoisotopic): 573.1450AlogP: 3.83#Rotatable Bonds: 13Polar Surface Area: 97.05Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.65CX LogP: 3.82CX LogD: 1.61Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.32Np Likeness Score: -0.86
References 1. Zhao F, Li J, Chen Y, Tian Y, Wu C, Xie Y, Zhou Y, Wang J, Xie X, Liu H.. (2016) Design, Synthesis, and Biological Evaluation of Indoline and Indole Derivatives as Potent and Selective α1A-Adrenoceptor Antagonists., 59 (8): [PMID:27031406 ] [10.1021/acs.jmedchem.5b02023 ]