The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-chloro-3-((E)-3-((3-((E)-2-(7-chloroquinolin-2-yl)vinyl)phenyl)amino)-3-oxoprop-1-en-1-yl)-1Hindole-2-carboxylic acid ID: ALA3809333
PubChem CID: 127043242
Max Phase: Preclinical
Molecular Formula: C29H19Cl2N3O3
Molecular Weight: 528.40
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(/C=C/c1c(C(=O)O)[nH]c2cc(Cl)ccc12)Nc1cccc(/C=C/c2ccc3ccc(Cl)cc3n2)c1
Standard InChI: InChI=1S/C29H19Cl2N3O3/c30-19-7-5-18-6-10-21(32-25(18)15-19)9-4-17-2-1-3-22(14-17)33-27(35)13-12-24-23-11-8-20(31)16-26(23)34-28(24)29(36)37/h1-16,34H,(H,33,35)(H,36,37)/b9-4+,13-12+
Standard InChI Key: WCTYCLNQJSPOCO-IUZWSJCJSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
-17.2053 -1.0248 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-15.7375 -0.7030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.6116 0.7547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.9562 1.3764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-17.4055 2.8118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-18.8933 3.1214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-19.8939 2.0107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-19.4311 0.5631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-17.9569 0.2657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.6084 -1.6878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.8384 -2.8656 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-13.4733 -1.2985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-14.3102 1.5023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.0116 0.7499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.7103 1.4975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.7081 2.6975 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.4117 0.7451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-9.1103 1.4927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8113 0.7426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5121 1.4924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5121 2.9924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8110 3.7426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1101 2.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2109 0.7445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9122 1.4966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6321 1.3486 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-21.0671 2.2631 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
1 9 1 0
4 9 2 0
10 11 2 0
10 12 1 0
2 10 1 0
13 14 2 0
14 15 1 0
15 16 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
18 23 2 0
24 25 2 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
26 35 1 0
30 35 1 0
33 36 1 0
25 27 1 0
20 24 1 0
17 18 1 0
15 17 1 0
3 13 1 0
7 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 528.40Molecular Weight (Monoisotopic): 527.0803AlogP: 7.54#Rotatable Bonds: 6Polar Surface Area: 95.08Molecular Species: ACIDHBA: 3HBD: 3#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.72CX Basic pKa: 3.01CX LogP: 6.72CX LogD: 3.84Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.20Np Likeness Score: -0.86
References 1. Chen H, Yang H, Wang Z, Xie X, Nan F.. (2016) Discovery of 3-Substituted 1H-Indole-2-carboxylic Acid Derivatives as a Novel Class of CysLT1 Selective Antagonists., 7 (3): [PMID:26985325 ] [10.1021/acsmedchemlett.5b00482 ]