N-(1-Acetyl-1H-indol-3-yl)-N-(2-hydroxyphenyl)acetamide

ID: ALA3809350

PubChem CID: 127043082

Max Phase: Preclinical

Molecular Formula: C18H16N2O3

Molecular Weight: 308.34

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)N(c1ccccc1O)c1cn(C(C)=O)c2ccccc12

Standard InChI:  InChI=1S/C18H16N2O3/c1-12(21)19-11-17(14-7-3-4-8-15(14)19)20(13(2)22)16-9-5-6-10-18(16)23/h3-11,23H,1-2H3

Standard InChI Key:  JDDJSRMODGLKBM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1855   -2.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3877   -3.5218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3606   -2.8684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1812    2.6271    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6500    2.9355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6488    1.8163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1174    2.1217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5873    3.5462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5886    4.6654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1200    4.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1824    3.7473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5580    4.8870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0075    3.5032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3211    5.2554    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  7 10  1  0
 10 11  1  0
 10 12  2  0
  9 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 13 20  1  0
 20 21  2  0
 20 22  1  0
 19 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3809350

    ---

Associated Targets(Human)

BAZ2B Tchem Bromodomain adjacent to zinc finger domain protein 2B (56204 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 308.34Molecular Weight (Monoisotopic): 308.1161AlogP: 3.69#Rotatable Bonds: 2
Polar Surface Area: 62.54Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.52CX Basic pKa: CX LogP: 1.85CX LogD: 1.82
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.79Np Likeness Score: -0.51

References

1. Unzue A, Zhao H, Lolli G, Dong J, Zhu J, Zechner M, Dolbois A, Caflisch A, Nevado C..  (2016)  The "Gatekeeper" Residue Influences the Mode of Binding of Acetyl Indoles to Bromodomains.,  59  (7): [PMID:26982797] [10.1021/acs.jmedchem.5b01757]

Source