The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{4-[4-(1H-Benzimidazol-2-yl)-phenylamino]-2-morpholin-4-yl-[1,3,5]triazin-6-ylamino}-ethanol ID: ALA3809375
PubChem CID: 127044105
Max Phase: Preclinical
Molecular Formula: C22H24N8O2
Molecular Weight: 432.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: OCCNc1nc(Nc2ccc(-c3nc4ccccc4[nH]3)cc2)nc(N2CCOCC2)n1
Standard InChI: InChI=1S/C22H24N8O2/c31-12-9-23-20-27-21(29-22(28-20)30-10-13-32-14-11-30)24-16-7-5-15(6-8-16)19-25-17-3-1-2-4-18(17)26-19/h1-8,31H,9-14H2,(H,25,26)(H2,23,24,27,28,29)
Standard InChI Key: QWUQXEMQIXWUED-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
8.5716 0.4033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7060 1.8887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2114 1.7609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3536 2.9915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9903 4.3496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4848 4.4773 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3427 3.2468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1320 5.5807 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6372 5.4555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7813 6.6873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4201 8.0445 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9149 8.1698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7708 6.9380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8384 3.3715 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0761 0.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4347 -1.0784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9397 -1.2009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0896 0.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7275 1.3885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2225 1.5111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6949 2.1391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1906 2.2638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8754 1.2785 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
2 7 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
8 13 1 0
5 8 1 0
7 14 1 0
1 3 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 1 0
21 25 1 0
26 27 1 0
27 28 2 0
28 29 1 0
24 29 2 0
23 26 2 0
18 21 1 0
1 15 1 0
14 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 432.49Molecular Weight (Monoisotopic): 432.2022AlogP: 2.40#Rotatable Bonds: 7Polar Surface Area: 124.11Molecular Species: NEUTRALHBA: 9HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.56CX Basic pKa: 7.47CX LogP: 3.32CX LogD: 2.95Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.35Np Likeness Score: -1.54
References 1. Singla P, Luxami V, Paul K.. (2016) Synthesis and in vitro evaluation of novel triazine analogues as anticancer agents and their interaction studies with bovine serum albumin., 117 [PMID:27089212 ] [10.1016/j.ejmech.2016.03.088 ]