The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((2-ethyl-5,7-dimethyl-3H-imidazo[4,5-b]pyridin-3-yl)methyl)-8-((4-methylpiperazin-1-yl)methyl)-10,11-dihydro-5H-dibenzo[b,f]azepine ID: ALA3809413
PubChem CID: 9935504
Max Phase: Preclinical
Molecular Formula: C31H38N6
Molecular Weight: 494.69
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCc1nc2c(C)cc(C)nc2n1Cc1ccc2c(c1)CCc1cc(CN3CCN(C)CC3)ccc1N2
Standard InChI: InChI=1S/C31H38N6/c1-5-29-34-30-21(2)16-22(3)32-31(30)37(29)20-24-7-11-28-26(18-24)9-8-25-17-23(6-10-27(25)33-28)19-36-14-12-35(4)13-15-36/h6-7,10-11,16-18,33H,5,8-9,12-15,19-20H2,1-4H3
Standard InChI Key: INKZQGYAHPSKHM-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
0.8722 -1.3706 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1246 1.9313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6509 1.9313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2272 -0.7320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5854 0.7009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0183 1.1214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1241 0.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7970 -1.3083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3486 -1.7444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7943 0.7632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4672 -0.7164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5730 -1.7444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0215 -1.2460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3330 0.1557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2272 1.1993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7740 0.5766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1313 2.0343 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.5706 2.4569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.9244 3.9145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8389 4.9498 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.3996 4.5273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0458 3.0697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1219 6.1159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5661 0.5103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6483 -0.5295 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7653 -2.6411 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4186 -1.9745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8061 -1.5702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1032 -0.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8856 1.0337 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4042 0.9751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1072 -0.3444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3086 -1.6374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8696 -2.6982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0416 1.9918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0851 -2.6577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0241 -3.8561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11 1 1 0
1 4 1 0
10 2 1 0
5 3 1 0
2 3 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
14 16 1 0
16 17 1 0
17 18 1 0
17 22 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
20 23 1 0
7 24 1 0
24 25 1 0
25 29 1 0
28 26 1 0
26 27 2 0
27 25 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
33 34 1 0
31 35 1 0
27 36 1 0
36 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.69Molecular Weight (Monoisotopic): 494.3158AlogP: 5.25#Rotatable Bonds: 5Polar Surface Area: 49.22Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.03CX LogP: 5.62CX LogD: 4.89Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.41Np Likeness Score: -1.34
References 1. Fukuda H, Ito S, Watari K, Mogi C, Arisawa M, Okajima F, Kurose H, Shuto S.. (2016) Identification of a Potent and Selective GPR4 Antagonist as a Drug Lead for the Treatment of Myocardial Infarction., 7 (5): [PMID:27190599 ] [10.1021/acsmedchemlett.6b00014 ]