The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,3S,4R,5R)-3,4-Dihydroxy-5-(6-{3-[4-(pyridin-2-ylsulfamoyl)-phenyl]-ureido}-purin-9-yl)-tetrahydro-furan-2-carboxylic acid ethylamide ID: ALA380943
PubChem CID: 10793414
Max Phase: Preclinical
Molecular Formula: C24H25N9O7S
Molecular Weight: 583.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NC(=O)Nc4ccc(S(=O)(=O)Nc5ccccn5)cc4)ncnc32)[C@H](O)[C@@H]1O
Standard InChI: InChI=1S/C24H25N9O7S/c1-2-25-22(36)19-17(34)18(35)23(40-19)33-12-29-16-20(27-11-28-21(16)33)31-24(37)30-13-6-8-14(9-7-13)41(38,39)32-15-5-3-4-10-26-15/h3-12,17-19,23,34-35H,2H2,1H3,(H,25,36)(H,26,32)(H2,27,28,30,31,37)/t17-,18+,19-,23+/m0/s1
Standard InChI Key: GMZSVEGPESZJKL-QPXQOZNCSA-N
Molfile:
RDKit 2D
41 45 0 0 1 0 0 0 0 0999 V2000
0.0662 -3.5881 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7105 -3.8710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7333 -4.0732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3280 -2.7978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9751 -4.6557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3732 -3.3819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3986 -3.5927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8176 -4.8950 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1407 -2.8019 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7949 -4.6515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4926 -5.3325 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0453 -3.8654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1515 -3.9309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5742 -5.2347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2885 -5.3200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8337 -3.6118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2388 -4.7489 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8245 -3.4407 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0079 -2.8088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4471 -4.1668 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2277 -3.9109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8369 -4.4658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5789 -3.7756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2461 -3.2897 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6662 -4.5963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0828 -4.4404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4206 -4.9312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5153 -5.7480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2714 -6.0753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9338 -5.5795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8359 -4.7644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6927 -5.9042 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.4035 -6.3155 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0624 -5.1663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3271 -6.6442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1188 -5.9035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8309 -6.3215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5457 -5.9102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5469 -5.0839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8274 -4.6707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1157 -5.0844 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16 20 1 0
2 1 1 1
20 21 1 0
1 3 1 0
21 22 1 0
1 4 1 0
18 23 1 0
5 2 1 0
23 24 2 0
2 6 1 0
23 25 1 0
25 27 1 0
3 7 1 0
3 8 2 0
26 27 2 0
4 9 2 0
27 28 1 0
5 10 1 0
28 29 2 0
5 11 1 6
29 30 1 0
6 12 1 0
30 31 2 0
31 26 1 0
7 13 2 0
30 32 1 0
8 14 1 0
32 33 1 0
10 15 1 6
32 34 2 0
12 16 1 1
32 35 2 0
13 17 1 0
33 36 1 0
13 18 1 0
36 37 2 0
16 19 2 0
37 38 1 0
7 9 1 0
38 39 2 0
10 12 1 0
39 40 1 0
14 17 2 0
40 41 2 0
41 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 583.59Molecular Weight (Monoisotopic): 583.1598AlogP: 0.42#Rotatable Bonds: 8Polar Surface Area: 222.58Molecular Species: NEUTRALHBA: 12HBD: 6#RO5 Violations: 3HBA (Lipinski): 16HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 6.98CX Basic pKa: 2.15CX LogP: -0.16CX LogD: -0.61Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.17Np Likeness Score: -0.84
References 1. González MP, Terán C, Teijeira M.. (2006) A topological function based on spectral moments for predicting affinity toward A3 adenosine receptors., 16 (5): [PMID:16356715 ] [10.1016/j.bmcl.2005.11.063 ]