The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[4-(1H-benzimidazol-2-yl)-phenyl]-(6-furan-2-yl-2-morpholin-4-yl-[1,3,5]triazin-4-yl)-amine ID: ALA3809440
PubChem CID: 127044566
Max Phase: Preclinical
Molecular Formula: C24H21N7O2
Molecular Weight: 439.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: c1coc(-c2nc(Nc3ccc(-c4nc5ccccc5[nH]4)cc3)nc(N3CCOCC3)n2)c1
Standard InChI: InChI=1S/C24H21N7O2/c1-2-5-19-18(4-1)26-21(27-19)16-7-9-17(10-8-16)25-23-28-22(20-6-3-13-33-20)29-24(30-23)31-11-14-32-15-12-31/h1-10,13H,11-12,14-15H2,(H,26,27)(H,25,28,29,30)
Standard InChI Key: LJNCGNYOJWZZBS-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 38 0 0 0 0 0 0 0 0999 V2000
8.5716 0.4033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4848 4.4773 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3427 3.2468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7060 1.8887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2114 1.7609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3536 2.9915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9903 4.3496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8380 3.3746 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4770 4.7317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9717 4.8570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8276 3.6252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1888 2.2681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6940 2.1427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6448 5.5944 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1320 5.5807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6380 6.9793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4433 7.8864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2114 7.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0761 0.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4347 -1.0784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9397 -1.2009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0896 0.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7275 1.3885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2225 1.5111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
2 7 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
8 13 1 0
3 8 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
14 18 1 0
7 15 1 0
1 5 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
19 24 2 0
25 26 2 0
26 27 1 0
27 28 1 0
28 29 1 0
25 29 1 0
30 31 1 0
31 32 2 0
32 33 1 0
28 33 2 0
27 30 2 0
22 25 1 0
1 19 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.48Molecular Weight (Monoisotopic): 439.1757AlogP: 4.26#Rotatable Bonds: 5Polar Surface Area: 104.99Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.50CX Basic pKa: 5.26CX LogP: 5.05CX LogD: 5.05Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.42Np Likeness Score: -1.78
References 1. Singla P, Luxami V, Paul K.. (2016) Synthesis and in vitro evaluation of novel triazine analogues as anticancer agents and their interaction studies with bovine serum albumin., 117 [PMID:27089212 ] [10.1016/j.ejmech.2016.03.088 ]